| Identification | Back Directory | [Name]
(2R,3R,4R,5S)-1,1,2,3,4,5,6,6-octadeuteriohexane-1,2,3,4,5,6-hexol | [CAS]
287962-59-8 | [Synonyms]
D-Sorbitol-1,1,2,3,4,5,6,6-d8
(2R,3R,4R,5S)-1,1,2,3,4,5,6,6-octadeuteriohexane-1,2,3,4,5,6-hexol | [Molecular Formula]
C6H6D8O6 | [MDL Number]
MFCD08459673 | [MOL File]
287962-59-8.mol | [Molecular Weight]
190.221 |
| Chemical Properties | Back Directory | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [color ]
White to Off-White | [SMILES]
O[C@@]([C@@]([C@]([C@](C([2H])(O)[2H])([2H])O)([2H])O)([2H])O)([2H])C([2H])(O)[2H] | [CAS Number Unlabeled]
50-70-4 |
| Hazard Information | Back Directory | [Uses]
Isotope labelled D-Glucitol is a sugar alcohol obtained from the reduction of glucose and is naturally found in various fruits such as apples, pears and peaches. D-Glucitol has been widely used as a sweetener, laxative, various medical applications and in cosmetic products. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
|