| Identification | Back Directory | [Name]
Cystosphaerol | [CAS]
6901-60-6 | [Synonyms]
Cystosphaerol Saringosterol 24-Vinylcholest-5-ene-3β,24-diol (24ξ)-Stigmasta-5,28-diene-3β,24-diol | [Molecular Formula]
C23H17Cl2NO3 | [MOL File]
6901-60-6.mol | [Molecular Weight]
426.292 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C23H17Cl2NO3/c1-27-17-7-3-14(4-8-17)23-13-20(18-11-15(24)5-9-21(18)29-23)26-16-6-10-22(28-2)19(25)12-16/h3-13H,1-2H3/b26-20- | [InChIKey]
JLHOROBQDUHIJF-QOMWVZHYSA-N | [SMILES]
C1(C2=CC=C(OC)C=C2)OC2=C(C=C(Cl)C=C2)/C(=N\C2=CC=C(OC)C(Cl)=C2)/C=1 |
| Hazard Information | Back Directory | [Description]
Saringosterol, also known as Saningosterol and Cystosphaerol, is a selective LXRβ agonist. Saringosterol is racmic at the 24-position. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
ShangHaiXiangShuLi
|
| Tel: |
15900518299 |
| Website: |
www.hezefdc.com/ShowSupplierProductsList768310/0_EN.htm |
|