??2-???-5-???-4-?????????
|
|
??2-???-5-???-4-????????? ??
- ?? ?
- 311.5±37.0 °C(Predicted)
- ??
- 1.662±0.06 g/cm3(Predicted)
- ?? ??
- under inert gas (nitrogen or Argon) at 2–8 °C
- ?? ?? (pKa)
- 2.78±0.24(Predicted)
- ??
- Light yellow to yellow Solid
- InChI
- InChI=1S/C7H7BrN2O2/c1-12-7(11)4-2-6(9)10-3-5(4)8/h2-3H,1H3,(H2,9,10)
- InChIKey
- FJPDYKLTAURVRU-UHFFFAOYSA-N
- SMILES
- C1(N)=NC=C(Br)C(C(OC)=O)=C1
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ??? ?? | Xi | ||
|---|---|---|---|
| ?? ?? | IRRITANT | ||
| HS ?? | 2933399990 |
| ????(GHS): |
|
||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| ?? ?: | Warning | ||||||||||||||||||||||||||||
| ??·?? ??: |
|
||||||||||||||||||||||||||||
| ??????: |
|
??2-???-5-???-4-????????? C??? ??, ??, ??
??
Methyl 2-amino-5-bromo-4-pyridinecarboxylate is a halogenated derivative of pyridinecarboxylate. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.??2-???-5-???-4-????????? ?? ?? ? ???
???
?? ??
??2-???-5-???-4-????????? ?? ??
???( 145)?? ??
| ??? | ?? | ??? | ?? | ?? ? | ?? |
|---|---|---|---|---|---|
| Capot Chemical Co.,Ltd. | +86-（0）57185586718 +86-13336195806 |
sales@capot.com | China | 29640 | 60 |
| ATK CHEMICAL COMPANY LIMITED | +undefined-21-51877795 |
ivan@atkchemical.com | China | 33024 | 60 |
| career henan chemical co | +86-0371-86658258 +8613203830695 |
sales@coreychem.com | China | 29815 | 58 |
| Accela ChemBio Inc. | +1-858-6993322 |
info@accelachem.com | United States | 21193 | 58 |
| Shandong chuangyingchemical Co., Ltd. | 18853181302 |
sale@chuangyingchem.com | CHINA | 5906 | 58 |
| Alchem Pharmtech,Inc. | 8485655694 |
sales@alchempharmtech.com | United States | 63687 | 58 |
| Wuhan Chemwish Technology Co., Ltd | 027-67849912 |
sales@chemwish.com | CHINA | 10821 | 58 |
| Guangzhou Yuheng Pharmaceutical Technology Co., Ltd | +8613580539051 |
joe@yuhengpharm.com | CHINA | 21142 | 58 |
| SIMAGCHEM CORP | +86-5922680277 +86-13806087780 |
sale@simagchem.com | China | 17346 | 58 |
| ANHUI WITOP BIOTECH CO., LTD | +8615255079626 |
eric@witopchemical.com | China | 23541 | 58 |