3-????-4-?-????-1-?????tert-??????
3-????-4-?-????-1-?????tert-?????? ??
- ?? ?
- 328.2±42.0 °C(Predicted)
- ??
- 1.066±0.06 g/cm3(Predicted)
- ?? ??
- 2-8°C(protect from light)
- ?? ?? (pKa)
- 10.34±0.10(Predicted)
- ??
- Colorless to off-white Solid-Liquid Mixture
- InChI
- InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)15-8-11(9-15)10-4-6-14-7-5-10/h10-11,14H,4-9H2,1-3H3
- InChIKey
- NVJNOFWSEGNPKX-UHFFFAOYSA-N
- SMILES
- N1(C(OC(C)(C)C)=O)CC(C2CCNCC2)C1
??
- ?? ? ?? ??
- ?? ? ???? ?? (GHS)
| ????(GHS): |
|
| ?? ?: |
Warning |
| ??·?? ??: |
| ?? |
??·?? ?? |
?? ?? |
?? |
?? ? |
?? ?? |
P- ?? |
| H302 |
??? ??? |
?? ?? ?? - ?? |
?? 4 |
?? |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
??? ??? ??? |
????? ?? ????? |
?? 2 |
?? |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
?? ?? ??? ??? |
?? ? ?? ?? ??? ?? |
?? 2A |
?? |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
?? ???? ??? ? ?? |
?? ???? ?? - 1? ??;???? ?? |
?? 3 |
?? |
|
|
|
| ??????: |
| P264 |
?? ??? ?? ??? ????. |
| P264 |
?? ??? ?? ??? ????. |
| P270 |
? ??? ??? ??? ???, ???? ???? ???. |
| P280 |
????/???/???/?????? ?????. |
| P301+P312 |
??? ???? ??? ????(??)? ??? ????. |
| P302+P352 |
??? ??? ??? ?? ????. |
| P305+P351+P338 |
?? ??? ? ?? ?? ???? ????. ???? ?????? ?????. ?? ????. |
| P321 |
(…) ??? ???. |
| P330 |
?? ?????. |
| P332+P313 |
?? ??? ??? ???? ??· ??? ????. |
| P362 |
??? ??? ?? ?? ?? ????? |
| P501 |
...? ??? / ??? ?? ???. |
|
3-????-4-?-????-1-?????tert-?????? C??? ??, ??, ??
??
3-Piperidin-4-yl-azetidine-1-carboxylic acid tert-butyl ester is used in organic experiments and pharmaceutical synthesis.
???
3-Piperidin-4-yl-azetidine-1-carboxylic acid tert-butyl ester causes serious eye irritation, it may cause an allergic skin reaction.
3-????-4-?-????-1-?????tert-?????? ?? ?? ? ???
???
?? ??
3-????-4-?-????-1-?????tert-?????? ?? ??
???( 41)?? ??
3-????-4-?-????-1-?????tert-?????? ?? ??:
