| Company Name: |
Jilin Chinese Academy of Sciences-yanshen Technology |
| Tel: |
+undefined18143011203 |
| Email: |
info@chemextension.com |
| Products Intro: |
Product Name:5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) CAS:1467776-41-5 Purity:95%+ Package:1g;5g;10g;25g;50g;100g; Remarks:accept Custom Synthesis Services, support large packing
|
|
|
|
|
| Company Name: |
Aladdin Scientific |
| Tel: |
|
| Email: |
tp@aladdinsci.com |
| Products Intro: |
Product Name:5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) CAS:1467776-41-5 Purity:98.0%(HPLC) Package:$992.9/100mg;Bulk package Remarks:98.0%(HPLC)
|
|
|
|
|
| Company Name: |
TOKYO CHEMICAL INDUSTRY CO., LTD.
|
| Tel: |
03-36680489 |
| Email: |
Sales-JP@TCIchemicals.com |
| Products Intro: |
Product Name:5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) CAS:1467776-41-5 Purity:95-98% Package:100 mg
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Email: |
sales@tcieurope.eu |
| Products Intro: |
Product Name:5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) CAS:1467776-41-5 Purity:95-98% Package:100 mg
|
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Email: |
sales@tciamerica.com |
| Products Intro: |
Product Name:5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) CAS:1467776-41-5 Purity:95-98% Package:100 mg
|
|
| | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) Basic information |
| Product Name: | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) | | Synonyms: | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC);Naphtho[1,2-c:5,6-cμbis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester;Bpin2-NTz;5,10-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole);Naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole, 5,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;Naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole5,10-diboronic acid bis(pinacol) ester;Naphtho[1,2-c:5,6-c′]bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester | | CAS: | 1467776-41-5 | | MF: | C22H26B2N4O4S2 | | MW: | 496.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1467776-41-5.mol | ![Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) Structure](CAS/20210111/GIF/1467776-41-5.gif) |
| | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) Chemical Properties |
| Melting point | 377-382°C | | Boiling point | 628.4±50.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | pka | -3.71±0.30(Predicted) | | form | powder | | color | White to Yellow to Green | | InChI | 1S/C22H26B2N4O4S2/c1-19(2)20(3,4)30-23(29-19)13-9-11-12(15-17(13)27-33-25-15)10-14(18-16(11)26-34-28-18)24-31-21(5,6)22(7,8)32-24/h9-10H,1-8H3 | | InChIKey | VZCYKOASVMGCSP-UHFFFAOYSA-N | | SMILES | CC(O1)(C)C(C)(C)OB1C2=CC3=C(C=C(B4OC(C)(C)C(C)(C)O4)C5=NSN=C53)C6=NSN=C26 | | CAS DataBase Reference | 1467776-41-5 |
| WGK Germany | 3 | | HS Code | 2934.99.4400 | | Storage Class | 11 - Combustible Solids |
| | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) Usage And Synthesis |
| Uses | Ready-to-use precursor for synthesis of high-performance semiconducting polymers. |
| | Naphtho[1,2-c:5,6-c'bis[1,2,5]thiadiazole-5,10-diboronic acid bis(pinacol) ester 98% (HPLC) Preparation Products And Raw materials |
|