| Identification | Back Directory | [Name]
Deet-d10 | [CAS]
1215576-01-4 | [Synonyms]
Deet-d10 M-Det-d10 m-DETA-d10 Flypel-d10 Dieltamid-d10 ENT 22542-d10 m-Delphene-d10 Metadelphene-d10 DEET-(diethyl-d10) N,N-(Diethyl-d10)-m-toluamide N,N-(Diethyl-d10)-3-methylbenzamide 3-Methyl-N,N-(diethyl-d10)benzamide | [Molecular Formula]
C12H17NO | [MDL Number]
MFCD28118921 | [MOL File]
1215576-01-4.mol | [Molecular Weight]
191.269 |
| Chemical Properties | Back Directory | [Appearance]
Colorless to Amberlike Liquid | [storage temp. ]
Refrigerator | [solubility ]
Chloroform (Slightly), Methanol (Slightly) | [form ]
Oil | [color ]
Colourless to Yellow | [Stability:]
Hygroscopic. Light sensitive. | [Major Application]
agriculture environmental | [InChI]
1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3/i1D3,2D3,4D2,5D2 | [InChIKey]
MMOXZBCLCQITDF-IZUSZFKNSA-N | [SMILES]
O=C(N(C(C([2H])([2H])[2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])C1=CC(C)=CC=C1 |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|