| Identification | Back Directory | [Name]
1,25-Dihydroxyvitamin D3-[D3] (CertiMass solution) | [CAS]
128723-16-0 | [Synonyms]
Calcitriol-d3 2H3]-1,25-DihydroxyVitamin D3 Calcitriol (6,19,19-d3) solution 1,25-Dihydroxyvitamin D3-[d3] (Solution) 1alpha,25-Dihydroxyvitamin D3 (6,19,19-d3) 1a,25-Dihydroxyvitamin D(3) (6,19,19-d(3)) 1α,25-Dihydroxyvitamin D3 (6,19,19-d3)
Deuterated 1-α25-Dihydroxyvitamin D3 solution 1,25-Dihydroxyvitamin D3-[D3] (CertiMass solution) 1alpha,25-Dihydroxyvitamin D3 (6,19,19-d3) solution 1α,25-Dihydroxycholecalciferol (6,19,19-d3) solution 1alpha,25-Dihydroxyvitamin D3 (6,19,19-d3) 97 atom % D, 96% (CP) 1α,25-Dihydroxyvitamin D3 (6,19,19-d3) solution 1,25 diHydroxy Cholecalciferol D3Q: What is
1,25 diHydroxy Cholecalciferol D3 Q: What is the CAS Number of
1,25 diHydroxy Cholecalciferol D3 (1R,3S,5E)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]-1-deuterioethylidene]-4-(dideuteriomethylidene)cyclohexane-1,3-diol | [Molecular Formula]
C27H41D3O3 | [MDL Number]
MFCD11656440 | [MOL File]
128723-16-0.mol | [Molecular Weight]
419.66 |
| Chemical Properties | Back Directory | [Melting point ]
-144.0 °C | [Boiling point ]
565.009±50.00 °C(Press: 760.00 Torr)(predicted) | [density ]
1.063±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [Fp ]
14 °C | [storage temp. ]
-20°C | [form ]
solution | [pka]
14.435±0.40(predicted) | [color ]
colorless | [InChIKey]
GMRQFYUYWCNGIN-POLIPXRRSA-N | [SMILES]
C[C@]12CCC/C(/[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C)=C\C(\[2H])=C1\C[C@H](C[C@@H](\C\1=C(/[2H])\[2H])O)O |
| Hazard Information | Back Directory | [Uses]
1α,25-Dihydroxyvitamin D3?(6,19,19-d3) can be used as a stable isotope internal standard for accurate data interpretation in specific biological samples by mass spectrometry. | [General Description]
1α,25-Dihydroxyvitamin D3?[1,25(OH)2D3], also known as calcitriol, plays a role in calcium and phosphate metabolism in humans. It also regulates insulin secretion and induces cellular differentiation. 1α,25-Dihydroxyvitamin D3?(6,19,19-d3) is a deuterated vitamin D3 wherein C-6 and C-19 protons are replaced by deuterium. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Entegris, Inc.
|
| Tel: |
021-52980362 18121213678 |
| Website: |
https://www.entegris.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
|