| Identification | Back Directory | [Name]
4’-Azido-3’-O-benzoyl-5’-O-(m-chlorobenzoyl)-2’-deoxy-2’-fluoro-beta-D-arabinouridine | [CAS]
1333126-30-9 | [Synonyms]
4’-Azido-3’-O-benzoyl-5’-O-(m-chlorobenzyl)-2’-deoxy-2’-fluoro-β-Darabinouridine 4’-Azido-3’-O-benzoyl-5’-O-(m-chlorobenzoyl)-2’-deoxy-2’-fluoro-beta-D-arabinouridine 1-[4-Azido-3-O-benzoyl-5-O-(3-chlorobenzoyl)-(2-deoxy-2-fluoro-b-D-arabinofuranosyl)uracil | [Molecular Formula]
C23H17ClFN5O7 | [MOL File]
1333126-30-9.mol | [Molecular Weight]
529.87 |
| Chemical Properties | Back Directory | [InChIKey]
ZSOIOSPOWYBGRD-MOSRZVNLNA-N | [SMILES]
C([C@]1(O[C@@H](N2C=CC(=O)NC2=O)[C@@H](F)[C@@H]1OC(C1C=CC=CC=1)=O)N=[N+]=[N-])OC(C1C=CC=C(Cl)C=1)=O |&1:1,3,12,14,r| |
| Hazard Information | Back Directory | [Uses]
1-[4-Azido-3-O-benzoyl-5-O-(3-chlorobenzoyl)-(2-Deoxy-2-fluoro-b-D-arabinofuranosyl)uracil is reported to be a reactant used for the preparation of 2''-deoxy-2''-fluoro-4''-azido nucleoside analogs which exhibited extremely potent anti-HIV activity against NL4-3 (wild-type), NL4-3 (K101E), and RTMDR viral strains. Also it is used for the synthesis of 4-substituted fluoronucleoside analogs for the treatment of Hepatitis B virus infection. |
|
| Company Name: |
Herd chemical Gold
|
| Tel: |
18051217850 |
| Website: |
http://www.herdchem.com/ |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
|