| Identification | Back Directory | [Name]
4-bromo-7-(2,2-dicyanovinyl)-2,1,3-benzothiadiazole | [CAS]
1335150-10-1 | [Synonyms]
BTDCV-Br 4-bromo-7-(2,2-dicyanovinyl)-2,1,3-benzothiadiazole 2-((7-Bromobenzo[c][1,2,5]thiadiazol-4-yl)methylene)malononitrile Propanedinitrile, 2-?[(7-?bromo-?2,?1,?3-?benzothiadiazol-?4-?yl)?methylene]?- | [Molecular Formula]
C10H3BrN4S | [MDL Number]
MFCD23704429 | [MOL File]
1335150-10-1.mol | [Molecular Weight]
291.13 |
| Chemical Properties | Back Directory | [Melting point ]
187.0 to 191.0 °C | [Boiling point ]
450.0±40.0 °C(Predicted) | [density ]
1.822±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [pka]
-3.28±0.50(Predicted) | [color ]
Light yellow to Yellow to Orange | [InChI]
InChI=1S/C10H3BrN4S/c11-8-2-1-7(3-6(4-12)5-13)9-10(8)15-16-14-9/h1-3H | [InChIKey]
ZNWYPDKJWGLSQU-UHFFFAOYSA-N | [SMILES]
C(#N)/C(=C/C1C2C(C(Br)=CC=1)=NSN=2)/C#N |
| Hazard Information | Back Directory | [Uses]
2-[(7-Bromo-2,1,3-benzothiadiazol-4-yl)methylene]propanedinitrile is a reagent for the synthesis of organic dyes used in solar cells. |
|
| Company Name: |
Wuxi SeniorMat. Co. Ltd. Gold
|
| Tel: |
181 189 19868; 13060007561 |
| Website: |
http://www.hezefdc.com/ShowSupplierProductsList17189/0_EN.htm |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13060007561 |
| Website: |
www.trustwe.com/ |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 13060007561 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 13060007561 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|