| Identification | Back Directory | [Name]
ML792 | [CAS]
1644342-14-2 | [Synonyms]
ML792 ML792 USP/EP/BP ML 792;ML792;ML-792;1644342-14-2 (1R,2S,4R)-4-[[5-[1-[(3-bromophenyl)methyl]pyrazole-3-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Sulfamic acid, [(1R,2S,4R)-4-[[5-[[1-[(3-bromophenyl)methyl]-1H-pyrazol-3-yl]carbonyl]-4-pyrimidinyl]amino]-2-hydroxycyclopentyl]methyl ester | [Molecular Formula]
C21H23BrN6O5S | [MDL Number]
MFCD32174257 | [MOL File]
1644342-14-2.mol | [Molecular Weight]
551.41 |
| Chemical Properties | Back Directory | [Boiling point ]
815.1±75.0 °C(Predicted) | [density ]
1.74±0.1 g/cm3(Predicted) | [storage temp. ]
Store at -20°C | [solubility ]
DMSO (with aid of ultrasonic):100.0(Max Conc. mg/mL);181.35(Max Conc. mM) | [form ]
A solid | [pka]
9.35±0.70(Predicted) | [color ]
White to off-white | [InChIKey]
PZCKLTWSXFDLLP-OGWOLHLISA-N | [SMILES]
S(N)(OC[C@H]1C[C@@H](NC2C(C(C3C=CN(CC4=CC=CC(Br)=C4)N=3)=O)=CN=CN=2)C[C@@H]1O)(=O)=O |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Twochem Co.Ltd
|
| Tel: |
021-021-58111628 15800915896 |
| Website: |
www.twochem.com |
|