| Identification | Back Directory | [Name]
potassium phenyl sulphate | [CAS]
1733-88-6 | [Synonyms]
potassium phenyl sulphate Sulfuric acid phenyl=potassium salt Sulfuric acid=phenyl=potassium salt Sulfuric Acid Phenyl Ester Potassium Salt Sulfuric acid, monophenyl ester, potassium salt (1:1) | [EINECS(EC#)]
217-071-0 | [Molecular Formula]
C6H5KO4S | [MOL File]
1733-88-6.mol | [Molecular Weight]
212.265 |
| Chemical Properties | Back Directory | [Melting point ]
160°C(lit.) | [storage temp. ]
2-8°C | [solubility ]
water: soluble | [Water Solubility ]
Soluble in water | [form ]
powder to crystal | [color ]
White to Almost white | [λmax]
262nm(H2O)(lit.) | [InChI]
1S/C6H6O4S.K/c7-11(8,9)10-6-4-2-1-3-5-6;/h1-5H,(H,7,8,9);/q;+1/p-1 | [InChIKey]
NOUFXYHWAWIDNT-UHFFFAOYSA-M | [SMILES]
[K+].[S](=O)(=O)([O-])Oc1ccccc1 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-400-1332688 18019345275 |
| Website: |
http://www.rhawn.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Rhawn Reagent
|
| Tel: |
400-1332688 18019345275 |
| Website: |
https://www.rhawn.cn/ |
|