| Chemical Properties | Back Directory | [Melting point ]
185-188°C | [storage temp. ]
-20°C Freezer, Under inert atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [color ]
Off-White to Pale Brown | [InChI]
1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5+/m0/s1/i4+1 | [InChIKey]
CIWBSHSKHKDKBQ-DXEGWCNNSA-N | [SMILES]
OC[C@H](O)[C@H]1OC(=O)[13C](O)=C1O |
| Hazard Information | Back Directory | [Uses]
AS Labelled Ascorbic Acid and Physiological antioxidant, L-Ascorbic Acid-2-13C can be used as antimicrobial and antioxidant in foodstuffs.
|
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
TargetMol
|
| Tel: |
400-821-0310 15002144251 |
| Website: |
www.targetmol.cn/ |
| Company Name: |
Pharma Affiliates
|
| Tel: |
172-5066494 |
| Website: |
www.hezefdc.com/ShowSupplierProductsList694812/0_EN.htm |
|