| Identification | Back Directory | [Name]
NDI-C6 | [CAS]
23536-15-4 | [Synonyms]
S1090 NDI-C6 NTDA-C6 NTDA-C6H13 N,N′-(1-Hexyl)-1,4,5,8-naphthalenetetracarboxydiamide 2,7-Dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone Benzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone, 2,7-dihexyl- | [Molecular Formula]
C26H30N2O4 | [MDL Number]
MFCD23098734 | [MOL File]
23536-15-4.mol | [Molecular Weight]
434.53 |
| Chemical Properties | Back Directory | [Melting point ]
205-210°C | [Boiling point ]
606.7±38.0 °C(Predicted) | [density ]
1.217±0.06 g/cm3(Predicted) | [form ]
powder | [pka]
-2.50±0.20(Predicted) | [semiconductor properties]
N-type (mobility=0.7cm2/V·s) | [λmax]
380360342 nm in dichloromethane (lit.) | [InChI]
1S/C26H30N2O4/c1-3-5-7-9-15-27-23(29)17-11-13-19-22-20(14-12-18(21(17)22)24(27)30)26(32)28(25(19)31)16-10-8-6-4-2/h11-14H,3-10,15-16H2,1-2H3 | [InChIKey]
QGDZMDFMUJURJD-UHFFFAOYSA-N | [SMILES]
CCCCCCN1C(=O)c2ccc3C(=O)N(CCCCCC)C(=O)c4ccc(C1=O)c2c34 |
| Hazard Information | Back Directory | [Uses]
Used as an n-type semiconducting material in organic printed electronics. | [General Description]
2,7-Dihexylbenzo[lmn][3,8]phenanthroline-1,3,6,8(2H,7H)-tetrone is a low-molecular weight perylene derivative which is used as a n-type organic semiconductor in field-effect transistors (FETs). They have high electron mobilities and very good on/off current ratios even in the presence of air. They also possess good mechanical properties and good chemical resistance to a wide range of solvents. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 13060007561 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 13060007561 |
| Website: |
www.3achem.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 13060007561 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Organtec Ltd
|
| Tel: |
010-89719903 13060007561 |
| Website: |
www.organtec.cn |
|