| Identification | Back Directory | [Name]
6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone | [CAS]
328956-08-7 | [Synonyms]
6-Fluoro-4-(trifluoromethyl)quinolin-2-ol 6-Fluoro-4-(trifluoromethyl)quinolin-2-ol ,97% 6-Fluoro-4-(trifluoroMethyl)quinolin-2(1H)-one 6-fluoro-4-(trifluoromethyl)-1H-quinolin-2-one 6-Fluoro-4-(trifluoromethyl)-2(1H)-quinolinone 6-Fluoro-2-hydroxy-4-(trifluoroMethyl)quinoline, 97% | [Molecular Formula]
C10H5F4NO | [MDL Number]
MFCD10574950 | [MOL File]
328956-08-7.mol | [Molecular Weight]
231.15 |
| Chemical Properties | Back Directory | [Melting point ]
252-253 °C (decomp)(Solv: ethanol (64-17-5)) | [Boiling point ]
282 ºC | [density ]
1.468 | [Fp ]
124 ºC | [storage temp. ]
2-8°C | [pka]
9.33±0.70(Predicted) | [InChI]
InChI=1S/C10H5F4NO/c11-5-1-2-8-6(3-5)7(10(12,13)14)4-9(16)15-8/h1-4H,(H,15,16) | [InChIKey]
WUFRBOSKPZUGIS-UHFFFAOYSA-N | [SMILES]
N1C2=C(C=C(F)C=C2)C(C(F)(F)F)=CC1=O |
| Hazard Information | Back Directory | [Chemical Properties]
White solid | [Description]
As a quinoline derivative, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline is substituted with trifluoromethyl, hydroxyl, and fluoride groups. In particular, 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline can exist in a tautomeric form, known as quinolone, where the hydroxy group becomes a ketone and the imine changes to an amine. This compound is a precursor for synthesizing thioquinolines, which are used to develop non-cytotoxic, potent and selective antitubercular agents. The thiolation reaction is carried out using phosphorus pentasulfide in pyridine. |
|
| Company Name: |
Suzhouhongxiong Gold
|
| Tel: |
18051745768 18051745768; |
| Website: |
http://www.hezefdc.com/ShowSupplierProductsList1620141/0_EN.htm |
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|