| Identification | Back Directory | [Name]
N3-Asp(tBu)-OH (dicyclohexylammonium) salt | [CAS]
333366-23-7 | [Synonyms]
N3-Asp(OtBu)-OH.DCHA
N3-Asp(tBu)-OH (dicyclohexylammonium) salt
Azido-Asp(tBu)-OH (dicyclohexylammonium) salt
(2S)-Azidobutanedioic Acid 4-(1,1-Dimethylethyl) Ester
(S)-2-Azidosuccinic acid 4-tert-butyl ester (dicyclohexylammonium) salt
(S)-(-)-4-tert-Butyl hydrogen 2-azidosuccinate (dicyclohexylammonium) salt
(S)-2-Azidobutanedioic acid 4-tert-butyl ester (dicyclohexylammonium) salt
2-Azido-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoicacid-N-cyclohexylcyclohexanamine(1:1) | [Molecular Formula]
C8H13N3O4 | [MDL Number]
MFCD12545999 | [MOL File]
333366-23-7.mol | [Molecular Weight]
215.21 |
| Chemical Properties | Back Directory | [Melting point ]
34-38℃ | [form ]
powder | [Optical Rotation]
[α]/D -41±2°, c = 1% in ethanol | [BRN ]
8765080 | [Major Application]
peptide synthesis | [InChI]
1S/C12H23N.C8H13N3O4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-8(2,3)15-6(12)4-5(7(13)14)10-11-9/h11-13H,1-10H2;5H,4H2,1-3H3,(H,13,14)/t;5-/m.0/s1 | [InChIKey]
SFILIPDSTSNNNC-ZSCHJXSPSA-N | [SMILES]
C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC(=O)C[C@H](N=[N+]=[N-])C(O)=O |
| Hazard Information | Back Directory | [Uses]
(2S)-Azidobutanedioic Acid 4-(1,1-Dimethylethyl) Ester is a reagent used in the preparation of acyclic nucleoside phosphonates which contain 0-deazahypoxanthine for inhibition of plasmodial 6-oxopurine phosphoribosyltransferases. | [reaction suitability]
reaction type: click chemistry
reaction type: solution phase peptide synthesis |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|