| Identification | Back Directory | [Name]
1-(4-bromobutyl)-4-methoxybenzene | [CAS]
35191-43-6 | [Synonyms]
1-(4-bromobutyl)-4-methoxybenzene
Benzene, 1-(4-bromobutyl)-4-methoxy- | [Molecular Formula]
C11H15BrO | [MDL Number]
MFCD18431373 | [MOL File]
35191-43-6.mol | [Molecular Weight]
243.14 |
| Chemical Properties | Back Directory | [Boiling point ]
135 °C(Press: 2.5 Torr) | [density ]
1.263±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C11H15BrO/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8H,2-4,9H2,1H3 | [InChIKey]
ORLVTTVUPUULCW-UHFFFAOYSA-N | [SMILES]
C1(CCCCBr)=CC=C(OC)C=C1 |
| Questions And Answer | Back Directory | [Uses]
1-(4-bromobutyl)-4-methoxybenzene is used as an organic synthesis intermediate and can be used to prepare substances such as glycosides, polymer molecules and diphenylalkyl halides. |
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|