| Identification | Back Directory | [Name]
CCMP SODIUM SALT | [CAS]
54925-33-6 | [Synonyms]
CCMP SODIUM SALT Cytidine 3',5'-phosphoric acid sodium salt CYTIDINE 3':5'-CYCLIC MONOPHOSPHATE SODIUM SALT CYTIDINE-3',5'-CYCLIC MONOPHOSPHATE SODIUM SALT Cytidine-3',5'-cyclic monophosphate monosodium salt Cytidine-3'',5''-cyclic monophosphoric acid sodium salt Cytidine, cyclic 3',5'-(hydrogen phosphate), monosodium salt Cytidine, cyclic3',5'-(hydrogen phosphate), sodium salt (1:1) | [EINECS(EC#)]
259-397-6 | [Molecular Formula]
C9H11N3NaO7P | [MDL Number]
MFCD00037485 | [MOL File]
54925-33-6.mol | [Molecular Weight]
327.16 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [form ]
powder | [InChI]
1S/C9H12N3O7P.Na/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7;/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14);/q;+1/p-1/t4-,6-,7-,8-;/m1./s1 | [InChIKey]
RZAHVNCNTLFRHJ-IAIGYFSYSA-M | [SMILES]
[Na+].NC1=NC(=O)N(C=C1)[C@@H]2O[C@@H]3COP([O-])(=O)O[C@H]3[C@H]2O |
| Hazard Information | Back Directory | [Uses]
Cytidine 3',5'-Cyclic Monophosphate Monosodium Salt is a cAMP analog useful in cyclic nucleotide mapping of hyperpolarization-activated cyclic nucleotide-gated (HCN) channels. It can also be useful in the identification of ligands that promote protein stability, protein crystallization, and structure determination. | [Biochem/physiol Actions]
Produced by the hydrolysis of cytidine 5′-triphos-phate by the enzyme cytidylyl cyclase. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.hezefdc.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Enzo Biochem Inc
|
| Tel: |
Enzo Biochem Inc. 13797054060 |
| Website: |
www.enzo.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
|