| Identification | Back Directory | [Name]
DIMETHYL-D6 SULFIDE | [CAS]
926-09-0 | [Synonyms]
Dimethyl sulfide-d DIMETHYL SULFIDE-D6 DIMETHYL-D6 SULFIDE (METHYL SULFIDE)-D6 Di(2H3)methyl sulfide 1,1'-ThiobisMethane-d3 di[(2H3)methyl] sulphide HEXADEUTERODIMETHYL SULFIDE Dimethyl sulfide-d6 99 atom % D 1,1’-Thiobismethane-d3 (Dimethyl Sulfide-d6) trideuterio(trideuteriomethylsulfanyl)methane (Methyl sulfide)-d6, Hexadeuterodimethyl sulfide | [EINECS(EC#)]
213-133-6 | [Molecular Formula]
C2D6S | [MDL Number]
MFCD00044687 | [MOL File]
926-09-0.mol | [Molecular Weight]
68.17 |
| Chemical Properties | Back Directory | [Boiling point ]
36.5 °C (lit.) | [density ]
0.928 g/mL at 25 °C (lit.) | [refractive index ]
n20/D 1.431(lit.) | [Fp ]
−34 °F | [solubility ]
Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Sparingly) | [form ]
Liquid | [color ]
Colourless | [BRN ]
2036892 | [InChI]
1S/C2H6S/c1-3-2/h1-2H3/i1D3,2D3 | [InChIKey]
QMMFVYPAHWMCMS-WFGJKAKNSA-N | [SMILES]
[2H]C([2H])([2H])SC([2H])([2H])[2H] |
| Hazard Information | Back Directory | [Uses]
Isotope labelled 1,1тАЩ-Thiobismethane is used in the synthesis of heterocyclic carbene complexes that are toxic to cancer cells. It is also used in the synthesis of compounds displaying antimalarial activity. | [General Description]
Dimethyl sulfide-d6 [(CD3)2S] is a deuterated NMR solvent useful in NMR-based research and analyses. It can form 1:1 complex with halothane by the formation of C–H…S hydrogen bonds. During the reaction of (CD3)2S with singlet oxygen in aprotic solvents, the H-D exchange in the methyl group was observed. The electronic spectra of (CD3)2S has been measured between 1250 and 2500?. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
| Company Name: |
Medical Isotopes
|
| Tel: |
1-(603) 635-1722 |
| Website: |
www.medicalisotopes.com |
|