| Chemical Properties | Back Directory | [solubility ]
water: soluble | [form ]
powder or crystals | [Water Solubility ]
water: soluble | [InChIKey]
IIAWHKVLRMAJSN-MCDZGGTQSA-N | [SMILES]
CCN(CC)CC.Nc1ncnc2n(cnc12)[C@@H]3O[C@H](COP(O)(=O)OS(O)(=O)=O)[C@@H](OP(O)(O)=O)[C@H]3O |
| Hazard Information | Back Directory | [Uses]
Adenosine 3μ-phosphate 5μ-phosphosulfate triethylammonium salt has been used in the determination of human 3-O-sulfotransferase-1 (3-OST-1) and aryl-sulfotransferase (AST-IV) enzyme activity. | [Biological Activity]
3μ-Phosphoadenosine-5μ-phosphosulfate (PAPS) acts as a sulfate donor and serves as a substrate for sulfotransferases (STs). |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.hezefdc.com/ShowSupplierProductsList1701258/0_EN.htm |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|