5-Bromo-3-methoxypicolinic acid
|
|
|
- CAS-Nr.
- 1142191-66-9
- Englisch Name:
- 5-Bromo-3-methoxypicolinic acid
- Synonyma:
- Ambroxol Impurity I;5-Bromo-3-methoxypicolinic acid;5-Bromo-3-methoxy-pyridin-2-carboxylic acid;3-methoxy-5-bromopyridine-2-carboxylic acid;5-Bromo-3-methoxy-pyridine-2-carboxylic acid;2-Pyridinecarboxylic acid, 5-bromo-3-methoxy-
- CBNumber:
- CB02480444
- Summenformel:
- C7H6BrNO3
- Molgewicht:
- 232.03
- MOL-Datei:
- 1142191-66-9.mol
|
5-Bromo-3-methoxypicolinic acid Eigenschaften
- Siedepunkt:
- 333.8±42.0 °C(Predicted)
- Dichte
- 1.713±0.06 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- pka
- 3.30±0.10(Predicted)
- Aussehen
- Light brown to yellow Solid
- InChI
- InChI=1S/C7H6BrNO3/c1-12-5-2-4(8)3-9-6(5)7(10)11/h2-3H,1H3,(H,10,11)
- InChIKey
- UTRZGSGCVSZCCL-UHFFFAOYSA-N
- SMILES
- C1(C(O)=O)=NC=C(Br)C=C1OC
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25 |
|
|
| S-S?tze: |
45 |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P321 |
Besondere Behandlung |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P362 |
Kontaminierte Kleidung ausziehen und vor erneutem Tragen waschen. |
|
5-Bromo-3-methoxypicolinic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
5-Bromo-3-methoxypicolinic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
5-Bromo-3-methoxypicolinic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 83)Lieferanten
- 5-Bromo-3-methoxypicolinic acid
- 5-Bromo-3-methoxy-pyridine-2-carboxylic acid
- Ambroxol Impurity I
- 3-methoxy-5-bromopyridine-2-carboxylic acid
- 2-Pyridinecarboxylic acid, 5-bromo-3-methoxy-
- 5-Bromo-3-methoxy-pyridin-2-carboxylic acid
- 1142191-66-9