3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine
|
|
|
- CAS-Nr.
- 1214383-87-5
- Englisch Name:
- 3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine
- Synonyma:
- 5-broMo-6-(trifluoroMethyl)pyridin-2-ol;5-Bromo-6-(trifluoromethyl)-1H-pyridin-2-one;5-BroMo-6-(trifluoroMethyl)pyridin-2(1H)-one;3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine;2(1H)-Pyridinone, 5-bromo-6-(trifluoromethyl)-
- CBNumber:
- CB02503970
- Summenformel:
- C6H3BrF3NO
- Molgewicht:
- 241.99
- MOL-Datei:
- 1214383-87-5.mol
|
3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine Eigenschaften
- storage temp.
- 2-8°C
- Aussehen
- White to off-white Solid
- InChI
- InChI=1S/C6H3BrF3NO/c7-3-1-2-4(12)11-5(3)6(8,9)10/h1-2H,(H,11,12)
- InChIKey
- KJFWXIMKNYWQDD-UHFFFAOYSA-N
- SMILES
- C1(=O)NC(C(F)(F)F)=C(Br)C=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H320 |
Causes eye irritation |
Serious eye damage/eye irritation |
Category 2B |
Warnung |
|
P264, P305+P351+P338,P337+P313 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P330 |
Mund ausspülen. |
|
3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 40)Lieferanten
- 3-Bromo-6-hydroxy-2-(trifluoromethyl)pyridine
- 5-broMo-6-(trifluoroMethyl)pyridin-2-ol
- 5-BroMo-6-(trifluoroMethyl)pyridin-2(1H)-one
- 5-Bromo-6-(trifluoromethyl)-1H-pyridin-2-one
- 2(1H)-Pyridinone, 5-bromo-6-(trifluoromethyl)-
- 1214383-87-5