(1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide
|
|
|
- CAS-Nr.
- 144866-90-0
- Englisch Name:
- (1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide
- Synonyma:
- (1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide
- CBNumber:
- CB02638160
- Summenformel:
- C16H26IN3O2
- Molgewicht:
- 419.30101
- MOL-Datei:
- 144866-90-0.mol
|
(1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide Eigenschaften
- Schmelzpunkt:
- 138-143°C
- Aggregatzustand
- solid
- InChI
- 1S/C16H24N3O2.HI/c1-16(2,3)21-15(20)18-10-12(11-19(4,5)6)13-8-7-9-17-14(13)18;/h7-10H,11H2,1-6H3;1H/q+1;/p-1
- InChIKey
- MAUXQSQPLVQYAG-UHFFFAOYSA-M
- SMILES
- [I-].CC(C)(C)OC(=O)n1cc(C[N+](C)(C)C)c2cccnc12
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25-36/37/38 |
|
|
| S-S?tze: |
26-45 |
|
|
| RIDADR |
UN 2811 6.1 / PGIII |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials |
|
|
| Hazard Classifications |
Acute Tox. 2 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H300 |
Lebensgefahr bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 2 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
(1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide Chemische Eigenschaften,Einsatz,Produktion Methoden
(1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
(1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 6)Lieferanten
- (1-Boc-7-azaindol-3-Methyl)triMethylaMMoniuM iodide
- 144866-90-0
