5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid
|
|
|
- CAS-Nr.
- 1171920-15-2
- Englisch Name:
- 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid
- Synonyma:
- 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid;1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-(trifluoromethyl)-
- CBNumber:
- CB02656445
- Summenformel:
- C9H5F3N2O2
- Molgewicht:
- 230.14
- MOL-Datei:
- 1171920-15-2.mol
|
5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Eigenschaften
- storage temp.
- 2-8°C
- Aggregatzustand
- solid
- Aussehen
- White to off-white Solid
- InChI
- 1S/C9H5F3N2O2/c10-9(11,12)4-1-5-6(8(15)16)3-14-7(5)13-2-4/h1-3H,(H,13,14)(H,15,16)
- InChIKey
- RYRSBBCTBCSZAK-UHFFFAOYSA-N
- SMILES
- OC(=O)c1c[nH]c2ncc(cc12)C(F)(F)F
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25 |
|
|
| S-S?tze: |
45 |
|
|
| RIDADR |
UN 2811 6.1 / PGIII |
|
|
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 44)Lieferanten
1171920-15-2()Verwandte Suche:
- 5-(TrifluoroMethyl)-7-azaindole-3-carboxylic acid
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-(trifluoromethyl)-
- 1171920-15-2
