alpha-cyclopropyl-3,4-dimethylbenzyl alcohol
|
|
|
- CAS-Nr.
- 83949-35-3
- Englisch Name:
- alpha-cyclopropyl-3,4-dimethylbenzyl alcohol
- Synonyma:
- Einecs 281-394-3;α-Cyclopropyl-3,4-dimethylbenzenemethanol;α-Cyclopropyl-3,4-dimethylbenzenemethanol;alpha-cyclopropyl-3,4-dimethylbenzyl alcohol
- CBNumber:
- CB0889317
- Summenformel:
- C12H16O
- Molgewicht:
- 176.25484
- MOL-Datei:
- 83949-35-3.mol
|
alpha-cyclopropyl-3,4-dimethylbenzyl alcohol Eigenschaften
- Aggregatzustand
- solid
- InChI
- 1S/C12H16O/c1-8-3-4-11(7-9(8)2)12(13)10-5-6-10/h3-4,7,10,12-13H,5-6H2,1-2H3
- InChIKey
- NSHXDLNNWOMQPK-UHFFFAOYSA-N
- SMILES
- OC(C1=CC=C(C)C(C)=C1)C2CC2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
6.1A - Combustible, acute toxic Cat. 1 and 2
very toxic hazardous materials |
|
|
| Hazard Classifications |
Acute Tox. 1 Dermal
Acute Tox. 3 Oral
Aquatic Acute 1 |
|
|
| Bildanzeige (GHS) |
 
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
| H310 |
Lebensgefahr bei Hautkontakt. |
Acute toxicity,dermal |
Category 1, 2 |
Achtung |
|
P262, P264, P270, P280, P302+P350,P310, P322, P361, P363, P405, P501 |
| H400 |
Sehr giftig für Wasserorganismen. |
Kurzfristig (akut) gew?ssergef?hrdend |
Kategorie 1 |
Warnung |
|
P273, P391, P501 |
|
| Sicherheit |
| P262 |
Nicht in die Augen, auf die Haut oder auf die Kleidung gelangen lassen. |
| P273 |
Freisetzung in die Umwelt vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P391 |
Verschüttete Mengen aufnehmen. |
|
alpha-cyclopropyl-3,4-dimethylbenzyl alcohol Chemische Eigenschaften,Einsatz,Produktion Methoden
alpha-cyclopropyl-3,4-dimethylbenzyl alcohol Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
alpha-cyclopropyl-3,4-dimethylbenzyl alcohol Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 3)Lieferanten
- alpha-cyclopropyl-3,4-dimethylbenzyl alcohol
- α-Cyclopropyl-3,4-dimethylbenzenemethanol
- Einecs 281-394-3
- α-Cyclopropyl-3,4-dimethylbenzenemethanol
- 83949-35-3
