2-ETHOXYPYRIMIDINE-5-BORONICACID
|
|
|
- CAS-Nr.
- 1003043-55-7
- Englisch Name:
- 2-ETHOXYPYRIMIDINE-5-BORONICACID
- Synonyma:
- 2-ETHOXYPYRIMIDINE-5-BORONICACID;(2-Ethoxy-5-pyrimidinyl)boronic acid;Boronic acid, B-(2-ethoxy-5-pyrimidinyl)-;2-Ethoxypyrimidine-5-boronic acid - [E2621];5-Borono-2-ethoxypyrimidine, 5-Borono-2-ethoxy-1,3-diazine;2-Ethoxypyrimidine-5-boronic acid(contains varying amounts of anhydride)
- CBNumber:
- CB11215907
- Summenformel:
- C6H9BN2O3
- Molgewicht:
- 167.96
- MOL-Datei:
- 1003043-55-7.mol
|
2-ETHOXYPYRIMIDINE-5-BORONICACID Eigenschaften
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- Aussehen
- Light yellow to yellow Solid
- InChI
- InChI=1S/C6H9BN2O3/c1-2-12-6-8-3-5(4-9-6)7(10)11/h3-4,10-11H,2H2,1H3
- InChIKey
- VTPBKJXRYUDPAJ-UHFFFAOYSA-N
- SMILES
- B(C1=CN=C(OCC)N=C1)(O)O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xn |
|
|
| R-S?tze: |
22 |
|
|
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2933599590 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P321 |
Besondere Behandlung |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P362 |
Kontaminierte Kleidung ausziehen und vor erneutem Tragen waschen. |
|
2-ETHOXYPYRIMIDINE-5-BORONICACID Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
2-Ethoxypyrimidine-5-boronic acid
2-ETHOXYPYRIMIDINE-5-BORONICACID Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-ETHOXYPYRIMIDINE-5-BORONICACID Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 66)Lieferanten
1003043-55-7()Verwandte Suche:
- 2-ETHOXYPYRIMIDINE-5-BORONICACID
- 5-Borono-2-ethoxypyrimidine, 5-Borono-2-ethoxy-1,3-diazine
- Boronic acid, B-(2-ethoxy-5-pyrimidinyl)-
- (2-Ethoxy-5-pyrimidinyl)boronic acid
- 2-Ethoxypyrimidine-5-boronic acid - [E2621]
- 2-Ethoxypyrimidine-5-boronic acid(contains varying amounts of anhydride)
- 1003043-55-7
- C6H9BN2O3