2-Bromoterthiophene
|
|
|
- CAS-Nr.
- 94581-95-0
- Englisch Name:
- 2-Bromoterthiophene
- Synonyma:
- 5-Bromo-2,2':5',2''-terthiophene;2-Bromoterthiophene;5-Bromo-α-terthienyl;5-Bromo-2,2′:5′,2′′-terthiophene;2-Bromo-5,2′:5′,2′′-terthiophene;2,2':5',2''-Terthiophene, 5-bromo-;2-BROMO-5-(5-THIOPHEN-2-YLTHIOPHEN-2-YL)THIOPHENE
- CBNumber:
- CB12103638
- Summenformel:
- C12H7BrS3
- Molgewicht:
- 327.28
- MOL-Datei:
- 94581-95-0.mol
|
2-Bromoterthiophene Eigenschaften
- Schmelzpunkt:
- 135-138°C
- Siedepunkt:
- 389.9±37.0 °C(Predicted)
- Dichte
- 1.599±0.06 g/cm3(Predicted)
- storage temp.
- Storage temp. 2-8°C
- Aggregatzustand
- solid
- Aussehen
- Light yellow to yellow Solid
- InChI
- 1S/C12H7BrS3/c13-12-6-5-11(16-12)10-4-3-9(15-10)8-2-1-7-14-8/h1-7H
- InChIKey
- HNMURGGRBMOMLO-UHFFFAOYSA-N
- SMILES
- Brc1ccc(s1)-c2ccc(s2)-c3cccs3
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25-37/38-41 |
|
|
| S-S?tze: |
26-39-45 |
|
|
| RIDADR |
UN 2811 6.1 / PGIII |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |

|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
 |
P264, P270, P301+P310, P321, P330,P405, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H318 |
Verursacht schwere Augensch?den. |
Schwere Augensch?digung |
Kategorie 1 |
Achtung |
 |
P280, P305+P351+P338, P310 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-Bromoterthiophene Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Bromoterthiophene Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Bromoterthiophene Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 28)Lieferanten
- 2-Bromo-5,2′:5′,2′′-terthiophene
- 5-Bromo-2,2′:5′,2′′-terthiophene
- 5-Bromo-α-terthienyl
- 2-Bromoterthiophene
- 2,2':5',2''-Terthiophene, 5-bromo-
- 2-BROMO-5-(5-THIOPHEN-2-YLTHIOPHEN-2-YL)THIOPHENE
- 5-Bromo-2,2':5',2''-terthiophene
- 94581-95-0