2-Pyridinylboronic acid MIDA ester
|
|
|
- CAS-Nr.
- 1104637-58-2
- Englisch Name:
- 2-Pyridinylboronic acid MIDA ester
- Synonyma:
- 2-Pyridylboronic acid MIDA ester;2-Pyridinylboronic acid MIDA ester;Pyridine-2-boronic acid
MIDA ester;2-pyridylboronic acid methyliminodiacetic acid ester;2-Pyridinylboronic acid methyliminodiacetic acid ester;4-Methyl-8-(pyridin-2-yl)dihydro-4λ4,8λ4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione
- CBNumber:
- CB12523094
- Summenformel:
- C10H11BN2O4
- Molgewicht:
- 234.01634
- MOL-Datei:
- 1104637-58-2.mol
|
2-Pyridinylboronic acid MIDA ester Eigenschaften
- storage temp.
- 2-8°C
- Aggregatzustand
- solid
- InChI
- 1S/C10H11BN2O4/c1-13-6-9(14)16-11(17-10(15)7-13)8-4-2-3-5-12-8/h2-5H,6-7H2,1H3
- InChIKey
- OEKJACZNFHBYNV-UHFFFAOYSA-N
- SMILES
- CN1CC(=O)OB(OC(=O)C1)c2ccccn2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-Pyridinylboronic acid MIDA ester Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
2-Pyridinylboronic Acid MIDA Ester can be used for HIV replication inhibitors.
2-Pyridinylboronic acid MIDA ester Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Pyridinylboronic acid MIDA ester Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 30)Lieferanten
1104637-58-2()Verwandte Suche:
- 2-Pyridinylboronic acid MIDA ester
- 2-Pyridylboronic acid MIDA ester
- 2-Pyridinylboronic acid methyliminodiacetic acid ester
- Pyridine-2-boronic acid
MIDA ester
- 2-pyridylboronic acid methyliminodiacetic acid ester
- 4-Methyl-8-(pyridin-2-yl)dihydro-4λ4,8λ4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione
- 1104637-58-2