2-chloro-5-(3-chlorophenyl)Pyrimidine
|
|
|
- CAS-Nr.
- 74963-13-6
- Englisch Name:
- 2-chloro-5-(3-chlorophenyl)Pyrimidine
- Synonyma:
- 2-chloro-5-(3-chlorophenyl)Pyrimidine;Pyrimidine, 2-chloro-5-(3-chlorophenyl)-
- CBNumber:
- CB13097275
- Summenformel:
- C10H6Cl2N2
- Molgewicht:
- 225.07
- MOL-Datei:
- 74963-13-6.mol
|
2-chloro-5-(3-chlorophenyl)Pyrimidine Eigenschaften
- Siedepunkt:
- 400.2±28.0 °C(Predicted)
- Dichte
- 1.363±0.06 g/cm3(Predicted)
- Aggregatzustand
- solid
- pka
- -2.01±0.22(Predicted)
- InChI
- 1S/C10H6Cl2N2/c11-9-3-1-2-7(4-9)8-5-13-10(12)14-6-8/h1-6H
- InChIKey
- BKKPVWSCJCGWOA-UHFFFAOYSA-N
- SMILES
- ClC1=NC=C(C2=CC=CC(Cl)=C2)C=N1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
|
|
| Hazard Classifications |
Acute Tox. 1 Dermal Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |
|
|
| Bildanzeige (GHS) |

|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H310 |
Lebensgefahr bei Hautkontakt. |
Acute toxicity,dermal |
Category 1, 2 |
Achtung |
 |
P262, P264, P270, P280, P302+P350,P310, P322, P361, P363, P405, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H410 |
Sehr giftig für Wasserorganismen mit langfristiger Wirkung. |
Langfristig (chronisch) gew?ssergef?hrdend |
Kategorie 1 |
Warnung |
 |
P273, P391, P501 |
|
| Sicherheit |
| P262 |
Nicht in die Augen, auf die Haut oder auf die Kleidung gelangen lassen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P273 |
Freisetzung in die Umwelt vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P391 |
Verschüttete Mengen aufnehmen. |
|
2-chloro-5-(3-chlorophenyl)Pyrimidine Chemische Eigenschaften,Einsatz,Produktion Methoden
2-chloro-5-(3-chlorophenyl)Pyrimidine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-chloro-5-(3-chlorophenyl)Pyrimidine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 5)Lieferanten
- 2-chloro-5-(3-chlorophenyl)Pyrimidine
- Pyrimidine, 2-chloro-5-(3-chlorophenyl)-
- 74963-13-6