5-Chloro-2-phenoxyphenylacetic acid
|
|
|
- CAS-Nr.
- 70958-20-2
- Englisch Name:
- 5-Chloro-2-phenoxyphenylacetic acid
- Synonyma:
- 2-(5-chloro-2-phenoxyphenyl)acetic acid;2-(5-Chloro-2-phenoxyphenyl);5-Chloro-2-phenoxyphenylacetic acid;5-Chloro-2-benzyloxyphenylaceticacid;5-Chloro-2-phenoxybenzeneacetic acid;2-(5-Chloro-2-phenoxyphenyl)aceticaci;Benzeneacetic acid, 5-chloro-2-phenoxy-;2-(5-chloro-2-phenoxyphenyl)acetic acid (en);5-Chloro-2-phenoxyphenylacetic acid
Asenapine Int
- CBNumber:
- CB21263152
- Summenformel:
- C14H11ClO3
- Molgewicht:
- 262.69
- MOL-Datei:
- 70958-20-2.mol
|
5-Chloro-2-phenoxyphenylacetic acid Eigenschaften
- Schmelzpunkt:
- 123-125°C
- Siedepunkt:
- 395.1±32.0 °C(Predicted)
- Dichte
- 1.317±0.06 g/cm3(Predicted)
- storage temp.
- Sealed in dry,Room Temperature
- pka
- 3.91±0.10(Predicted)
- Aggregatzustand
- solid
- Aussehen
- White to off-white Solid
- InChI
- InChI=1S/C14H11ClO3/c15-11-6-7-13(10(8-11)9-14(16)17)18-12-4-2-1-3-5-12/h1-8H,9H2,(H,16,17)
- InChIKey
- PKMKNEIUKHPJAX-UHFFFAOYSA-N
- SMILES
- C1(CC(O)=O)=CC(Cl)=CC=C1OC1=CC=CC=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| WGK Germany |
WGK 3 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
2918999090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
5-Chloro-2-phenoxyphenylacetic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Synthesis Reference(s)
Journal of Medicinal Chemistry, 25, p. 855, 1982
DOI: 10.1021/jm00349a018
5-Chloro-2-phenoxyphenylacetic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
5-Chloro-2-phenoxyphenylacetic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 129)Lieferanten
- 5-Chloro-2-phenoxyphenylacetic acid
- 2-(5-chloro-2-phenoxyphenyl)acetic acid (en)
- Benzeneacetic acid, 5-chloro-2-phenoxy-
- 2-(5-Chloro-2-phenoxyphenyl)
- 2-(5-Chloro-2-phenoxyphenyl)aceticaci
- 5-Chloro-2-phenoxybenzeneacetic acid
- 5-Chloro-2-benzyloxyphenylaceticacid
- 5-Chloro-2-phenoxyphenylacetic acid
Asenapine Int
- 2-(5-chloro-2-phenoxyphenyl)acetic acid
- 70958-20-2
