6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline
|
|
|
- CAS-Nr.
- 675576-26-8
- Englisch Name:
- 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline
- Synonyma:
- Isoquinoline-6-boronic acid picol ester;Isoquinoline-6-boronic acid pinacol ester;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline;Isoquinoline, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOQUINOLINE 97%;6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (>85%)
- CBNumber:
- CB21562091
- Summenformel:
- C15H18BNO2
- Molgewicht:
- 255.12
- MOL-Datei:
- 675576-26-8.mol
|
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Eigenschaften
- Schmelzpunkt:
- 179-184°C
- Siedepunkt:
- 397.5±15.0 °C(Predicted)
- Dichte
- 1.10±0.1 g/cm3 (20 ºC 760 Torr)
- storage temp.
- 2-8°C
- L?slichkeit
- Chloroform (Slightly), Methanol (Slightly)
- Aggregatzustand
- solid
- pka
- 5.03±0.14(Predicted)
- Aussehen
- Off-white to light yellow Solid
- InChI
- 1S/C15H18BNO2/c1-14(2)15(3,4)19-16(18-14)13-6-5-12-10-17-8-7-11(12)9-13/h5-10H,1-4H3
- InChIKey
- LFALMDZWCMSBFO-UHFFFAOYSA-N
- SMILES
- CC1(C)OB(OC1(C)C)c2ccc3cnccc3c2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36/37/38 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P271 |
Nur im Freien oder in gut belüfteten R?umen verwenden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
Useful boron compound for Suzuki coupling.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 47)Lieferanten
- 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline
- Isoquinoline-6-boronic acid pinacol ester
- 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOQUINOLINE 97%
- Isoquinoline-6-boronic acid picol ester
- Isoquinoline, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (>85%)
- 675576-26-8