2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester
|
|
|
- CAS-Nr.
- 1314216-34-6
- Englisch Name:
- 2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester
- Synonyma:
- 2-Methylbenzimidazole-5-boronic Acid Pinacol Ester;2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester;2-Methyl-1H-benzimidazole-5-boronic acid pinacol ester;2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole;2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidazole;2-Methyl-6-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]iMidazole
- CBNumber:
- CB22564151
- Summenformel:
- C14H19BN2O2
- Molgewicht:
- 258.12
- MOL-Datei:
- 1314216-34-6.mol
|
2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester Eigenschaften
- storage temp.
- 2-8°C
- Aggregatzustand
- Solid
- Farbe
- White to pale yellow
- InChI
- InChI=1S/C14H19BN2O2/c1-9-16-11-7-6-10(8-12(11)17-9)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17)
- InChIKey
- CPQGLMCLTALRHF-UHFFFAOYSA-N
- SMILES
- C1(C)NC2=CC(B3OC(C)(C)C(C)(C)O3)=CC=C2N=1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2933998090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 34)Lieferanten
- 2-Methyl-1h-benzimidazole-5-boronic acid pinacol ester
- 2-Methyl-6-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]iMidazole
- 2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazole
- 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidazole
- 2-Methylbenzimidazole-5-boronic Acid Pinacol Ester
- 2-Methyl-1H-benzimidazole-5-boronic acid pinacol ester
- 1314216-34-6
