2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride
|
|
|
- CAS-Nr.
- 1216497-60-7
- Englisch Name:
- 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride
- Synonyma:
- 2-(2,4-dichlorophenyl)propan-2-amine HCl;2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride;Benzenemethanamine, 2,4-dichloro-α,α-dimethyl-, hydrochloride (1:1)
- CBNumber:
- CB22743929
- Summenformel:
- C9H12Cl3N
- Molgewicht:
- 240.55
- MOL-Datei:
- 1216497-60-7.mol
|
2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride Eigenschaften
- storage temp.
- Inert atmosphere,Room Temperature
- Aggregatzustand
- solid
- Aussehen
- White to off-white Solid
- InChI
- 1S/C9H11Cl2N.ClH/c1-9(2,12)7-4-3-6(10)5-8(7)11;/h3-5H,12H2,1-2H3;1H
- InChIKey
- DONBZZYSLNXYQI-UHFFFAOYSA-N
- SMILES
- ClC1=CC(Cl)=CC=C1C(C)(C)N.Cl
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Dam. 1 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
|
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P310 |
Sofort GIFTINFORMATIONSZENTRUM/Arzt/ anrufen. |
|
2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride Chemische Eigenschaften,Einsatz,Produktion Methoden
2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 40)Lieferanten
- 2-(2,4-Dichlorophenyl)propan-2-amine hydrochloride
- 2-(2,4-dichlorophenyl)propan-2-amine HCl
- Benzenemethanamine, 2,4-dichloro-α,α-dimethyl-, hydrochloride (1:1)
- 1216497-60-7
