Phenylacetic acid-4-boronic acid pinacol ester
|
|
|
- CAS-Nr.
- 797755-07-8
- Englisch Name:
- Phenylacetic acid-4-boronic acid pinacol ester
- Synonyma:
- 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid;4-(Carboxymethyl)phenylboronic acidpinacol ester;4-(Carboxymethyl)phenylboronic acid pinacol ester 95%;2-[4-(Carboxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;[4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)phenyl]acetic acid;Benzeneacetic acid, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- CBNumber:
- CB31177186
- Summenformel:
- C14H19BO4
- Molgewicht:
- 262.11
- MOL-Datei:
- 797755-07-8.mol
|
Phenylacetic acid-4-boronic acid pinacol ester Eigenschaften
- Schmelzpunkt:
- 165-170°C
- Siedepunkt:
- 398.2±25.0 °C(Predicted)
- Dichte
- 1.13±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- pka
- 4.24±0.10(Predicted)
- Aggregatzustand
- Crystalline Powder or Powder
- Farbe
- White to yellow
- InChI
- 1S/C14H19BO4/c1-13(2)14(3,4)19-15(18-13)11-7-5-10(6-8-11)9-12(16)17/h5-8H,9H2,1-4H3,(H,16,17)
- InChIKey
- FNLWHBHWDXCWHV-UHFFFAOYSA-N
- SMILES
- CC1(C)OB(OC1(C)C)c2ccc(CC(O)=O)cc2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36/37/38 |
|
|
| S-S?tze: |
26-36/37/39 |
|
|
| WGK Germany |
1 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
2931900090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P271 |
Nur im Freien oder in gut belüfteten R?umen verwenden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
Phenylacetic acid-4-boronic acid pinacol ester Chemische Eigenschaften,Einsatz,Produktion Methoden
Phenylacetic acid-4-boronic acid pinacol ester Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Phenylacetic acid-4-boronic acid pinacol ester Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 106)Lieferanten
- 4-(Carboxymethyl)phenylboronic acidpinacol ester
- 4-(Carboxymethyl)phenylboronic acid pinacol ester 95%
- [4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)phenyl]acetic acid
- 2-[4-(Carboxymethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- Benzeneacetic acid, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid
- 797755-07-8
- Boronic ester
- Organoborons
- Aryl