2-Bromo-3,5-difluorobenzotrifluoride
|
|
|
- CAS-Nr.
- 1099597-86-0
- Englisch Name:
- 2-Bromo-3,5-difluorobenzotrifluoride
- Synonyma:
- 2-Bromo-3,5-difluorobenzotrifluoride;2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene;Benzene, 2-bromo-1,5-difluoro-3-(trifluoromethyl)-
- CBNumber:
- CB31566122
- Summenformel:
- C7H2BrF5
- Molgewicht:
- 260.99
- MOL-Datei:
- 1099597-86-0.mol
|
2-Bromo-3,5-difluorobenzotrifluoride Eigenschaften
- Siedepunkt:
- 149.1±35.0 °C(Predicted)
- Dichte
- 1.768±0.06 g/cm3(Predicted)
- storage temp.
- Storage temp. 2-8°C
- Aggregatzustand
- solid
- Aussehen
- Colorless to light yellow Liquid
- InChI
- 1S/C7H2BrF5/c8-6-4(7(11,12)13)1-3(9)2-5(6)10/h1-2H
- InChIKey
- IJQIBUQQMOIJPX-UHFFFAOYSA-N
- SMILES
- FC(F)(F)c1c(c(cc(c1)F)F)Br
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi,T |
|
|
| R-S?tze: |
25 |
|
|
| S-S?tze: |
45 |
|
|
| WGK Germany |
WGK 3 |
|
|
| HazardClass |
IRRITANT |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
 |
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
2-Bromo-3,5-difluorobenzotrifluoride Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Bromo-3,5-difluorobenzotrifluoride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Bromo-3,5-difluorobenzotrifluoride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 17)Lieferanten
- 2-Bromo-3,5-difluorobenzotrifluoride
- 2-Bromo-1,5-difluoro-3-(trifluoromethyl)benzene
- Benzene, 2-bromo-1,5-difluoro-3-(trifluoromethyl)-
- 1099597-86-0