1-(4-Boronophenyl)cyclopropanecarbonitrile
|
|
|
- CAS-Nr.
- 1217501-00-2
- Englisch Name:
- 1-(4-Boronophenyl)cyclopropanecarbonitrile
- Synonyma:
- 4-(1-Cyanocyclopropyl)phenylboronic acid;1-(4-Boronophenyl)cyclopropanecarbonitrile;Boronic acid, B-[4-(1-cyanocyclopropyl)phenyl]-
- CBNumber:
- CB32564547
- Summenformel:
- C10H10BNO2
- Molgewicht:
- 187
- MOL-Datei:
- 1217501-00-2.mol
|
1-(4-Boronophenyl)cyclopropanecarbonitrile Eigenschaften
- Siedepunkt:
- 412.0±55.0 °C(Predicted)
- Dichte
- 1.26±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- pka
- 8.73±0.16(Predicted)
- Aggregatzustand
- solid
- Aussehen
- White to light yellow Solid
- InChI
- 1S/C10H10BNO2/c12-7-10(5-6-10)8-1-3-9(4-2-8)11(13)14/h1-4,13-14H,5-6H2
- InChIKey
- NOICYZKSQYFZPX-UHFFFAOYSA-N
- SMILES
- OB(O)c1ccc(cc1)C2(CC2)C#N
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2931900090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
 |
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P310 |
Sofort GIFTINFORMATIONSZENTRUM/Arzt/ anrufen. |
|
1-(4-Boronophenyl)cyclopropanecarbonitrile Chemische Eigenschaften,Einsatz,Produktion Methoden
1-(4-Boronophenyl)cyclopropanecarbonitrile Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
1-(4-Boronophenyl)cyclopropanecarbonitrile Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 50)Lieferanten
- 1-(4-Boronophenyl)cyclopropanecarbonitrile
- 4-(1-Cyanocyclopropyl)phenylboronic acid
- Boronic acid, B-[4-(1-cyanocyclopropyl)phenyl]-
- 1217501-00-2