3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine
|
|
|
- CAS-Nr.
- 1206641-26-0
- Englisch Name:
- 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Synonyma:
- 5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester;5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester, 95%;3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine;Pyridine, 3-(methylsulfonyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- CBNumber:
- CB32632215
- Summenformel:
- C12H18BNO4S
- Molgewicht:
- 283.15
- MOL-Datei:
- 1206641-26-0.mol
|
3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Eigenschaften
- Siedepunkt:
- 462.2±45.0 °C(Predicted)
- Dichte
- 1.21±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- pka
- 1.67±0.22(Predicted)
- Aussehen
- Light brown to brown Solid
- InChI
- 1S/C12H18BNO4S/c1-11(2)12(3,4)18-13(17-11)9-6-10(8-14-7-9)19(5,15)16/h6-8H,1-5H3
- InChIKey
- BFWBUXKEBXAKDE-UHFFFAOYSA-N
- SMILES
- CC(O1)(C)C(C)(C)OB1C2=CN=CC(S(C)(=O)=O)=C2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T |
|
|
| R-S?tze: |
25 |
|
|
| S-S?tze: |
45 |
|
|
| RIDADR |
UN 2811 6.1 / PGIII |
|
|
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2933399990 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| Sicherheit |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
|
3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 47)Lieferanten
- 3-(Methylsulfonyl)-5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)pyridine
- 5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester, 95%
- Pyridine, 3-(methylsulfonyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 5-(Methylsulfonyl)pyridine-3-boronic acid pinacol ester
- 1206641-26-0
- 1206614-26-0
