2-(1,3-thiazol-4-yl)acetic acid
|
|
|
- CAS-Nr.
- 7504-44-1
- Englisch Name:
- 2-(1,3-thiazol-4-yl)acetic acid
- Synonyma:
- 2-(thiazol-4-yl)acetic acid;2-(4-Thiazolyl)acetic Acid;2-(Thiazol-4-yl);1,3-Thiazole-4-ylacetic acid;2-(1,3-thiazol-4-yl)acetic acid;4-Thiazoleacetic acid (8CI, 9CI, aci);1,3-Thiazol-4-ylacetic acid hydrochloride;2-(1,3-thiazol-4-yl)acetic acid - [T87367];1,3-thiazol-4-ylacetic acid(SALTDATA: FREE)
- CBNumber:
- CB41563784
- Summenformel:
- C5H5NO2S
- Molgewicht:
- 143.16
- MOL-Datei:
- 7504-44-1.mol
|
2-(1,3-thiazol-4-yl)acetic acid Eigenschaften
- Schmelzpunkt:
- 139 °C
- Siedepunkt:
- 313.7±17.0 °C(Predicted)
- Dichte
- 1.437±0.06 g/cm3(Predicted)
- storage temp.
- -20°C, sealed storage, away from moisture
- pka
- 4.07±0.10(Predicted)
- Aggregatzustand
- solid
- Aussehen
- Light brown to brown Solid
- InChI
- InChI=1S/C5H5NO2S/c7-5(8)1-4-2-9-3-6-4/h2-3H,1H2,(H,7,8)
- InChIKey
- PISMJKGQNDOCGA-UHFFFAOYSA-N
- SMILES
- S1C=C(CC(O)=O)N=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2934100090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Aquatic Chronic 3
Eye Dam. 1 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
|
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P310 |
Sofort GIFTINFORMATIONSZENTRUM/Arzt/ anrufen. |
|
2-(1,3-thiazol-4-yl)acetic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
2-(1,3-thiazol-4-yl)acetic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-(1,3-thiazol-4-yl)acetic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 56)Lieferanten
7504-44-1()Verwandte Suche:
- 1,3-Thiazole-4-ylacetic acid
- 2-(1,3-thiazol-4-yl)acetic acid
- 1,3-thiazol-4-ylacetic acid(SALTDATA: FREE)
- 1,3-Thiazol-4-ylacetic acid hydrochloride
- 2-(Thiazol-4-yl)
- 2-(4-Thiazolyl)acetic Acid
- 4-Thiazoleacetic acid (8CI, 9CI, aci)
- 2-(1,3-thiazol-4-yl)acetic acid - [T87367]
- 2-(thiazol-4-yl)acetic acid
- 7504-44-1
