2,3-Difluoro-4-(tributylstannyl)pyridine
|
|
|
- CAS-Nr.
- 1204580-71-1
- Englisch Name:
- 2,3-Difluoro-4-(tributylstannyl)pyridine
- Synonyma:
- SKL1079;3-Difluoro-4-(tributylstannyl)pyridine;Pyridine, 4-chloro-2-(tributylstannyl)-;tributyl-(4-chloropyridin-2-yl)stannane;2,3-Difluoro-4-(tributylstannyl)pyridine;tributyl-(2,3-difluoropyridin-4-yl)stannane;4-Chloro-2-(tributylstannyl)pyridine - [C2966];2,3-Difluoro-4-(tributylstannyl)pyridine-D3110
- CBNumber:
- CB42498638
- Summenformel:
- C17H30ClNSn
- Molgewicht:
- 402.59
- MOL-Datei:
- 1204580-71-1.mol
|
2,3-Difluoro-4-(tributylstannyl)pyridine Eigenschaften
- Dichte
- 1.233 g/mL at 25 °C
- Flammpunkt:
- >110℃
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- Aussehen
- Colorless to light yellow Liquid
- InChI
- 1S/C5H3ClN.3C4H9.Sn/c6-5-1-3-7-4-2-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;
- InChIKey
- ISUMXRDJZLNDIM-UHFFFAOYSA-N
- SMILES
- CCCC[Sn](CCCC)(CCCC)c1cc(Cl)ccn1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T,N |
|
|
| R-S?tze: |
21-25-36/38-48/23/25-50/53 |
|
|
| S-S?tze: |
36/37/39-45-60-61 |
|
|
| RIDADR |
UN 2788 6.1 / PGIII |
|
|
| WGK Germany |
3 |
|
|
| HS Code |
2931900090 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
|
|
| Bildanzeige (GHS) |
  
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 3 |
Achtung |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
| H312 |
Gesundheitssch?dlich bei Hautkontakt. |
Akute Toxizit?t dermal |
Kategorie 4 |
Warnung |
 |
P280,P302+P352, P312, P322, P363,P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H372 |
Sch?digt bei Hautkontakt und Verschlucken die Organe bei l?ngerer oder wiederholter Exposition. |
Spezifische Zielorgan-Toxizit?t (wiederholte Exposition) |
Kategorie 1 |
Achtung |
|
P260, P264, P270, P314, P501 |
| H410 |
Sehr giftig für Wasserorganismen mit langfristiger Wirkung. |
Langfristig (chronisch) gew?ssergef?hrdend |
Kategorie 1 |
Warnung |
|
P273, P391, P501 |
|
| Sicherheit |
| P202 |
Vor Gebrauch alle Sicherheitshinweise lesen und verstehen. |
| P273 |
Freisetzung in die Umwelt vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P310 |
BEI VERSCHLUCKEN: Sofort GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2,3-Difluoro-4-(tributylstannyl)pyridine Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
4-Chloro-2-(tributylstannyl)pyridine is used as a reactant in the synthesis of pyrrolo[2,1-f][1,2,4]triazine compounds as TGFB receptor antagonists.
2,3-Difluoro-4-(tributylstannyl)pyridine Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2,3-Difluoro-4-(tributylstannyl)pyridine Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 33)Lieferanten
- 2,3-Difluoro-4-(tributylstannyl)pyridine
- 3-Difluoro-4-(tributylstannyl)pyridine
- SKL1079
- Pyridine, 4-chloro-2-(tributylstannyl)-
- 2,3-Difluoro-4-(tributylstannyl)pyridine-D3110
- tributyl-(2,3-difluoropyridin-4-yl)stannane
- tributyl-(4-chloropyridin-2-yl)stannane
- 4-Chloro-2-(tributylstannyl)pyridine - [C2966]
- 1204580-71-1
- Stannanes
