6-Chloro-2-fluoropyridine-3-boronic acid
|
|
|
- CAS-Nr.
- 1256345-66-0
- Englisch Name:
- 6-Chloro-2-fluoropyridine-3-boronic acid
- Synonyma:
- 2-FLUORO-6-CHLOROPYRIDINE-3-BORONIC ACID;(6-Chloro-2-fluoropyridin-3-yl)boronic acid;6-Chloro-2-fluoropyridine-3-boronic acid≥ 98.5%;Boronic acid, B-(6-chloro-2-fluoro-3-pyridinyl)-;(6-Chloro-2-fluoropyridin-3-yl)boronic acid - [C18067]
- CBNumber:
- CB42565107
- Summenformel:
- C5H4BClFNO2
- Molgewicht:
- 175.35
- MOL-Datei:
- 1256345-66-0.mol
|
6-Chloro-2-fluoropyridine-3-boronic acid Eigenschaften
- Siedepunkt:
- 341.4±52.0 °C(Predicted)
- Dichte
- 1.51±0.1 g/cm3(Predicted)
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- pka
- 6.49±0.58(Predicted)
- Aussehen
- White to off-white Solid
- InChI
- InChI=1S/C5H4BClFNO2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2,10-11H
- InChIKey
- AYPTVURLQVNETR-UHFFFAOYSA-N
- SMILES
- B(C1=CC=C(Cl)N=C1F)(O)O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
37/38-41 |
|
|
| S-S?tze: |
26-39 |
|
|
| HS Code |
2933399990 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
6-Chloro-2-fluoropyridine-3-boronic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Chemische Eigenschaften
White to off-white solid
6-Chloro-2-fluoropyridine-3-boronic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
6-Chloro-2-fluoropyridine-3-boronic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 68)Lieferanten
- (6-Chloro-2-fluoropyridin-3-yl)boronic acid
- 6-Chloro-2-fluoropyridine-3-boronic acid≥ 98.5%
- 2-FLUORO-6-CHLOROPYRIDINE-3-BORONIC ACID
- Boronic acid, B-(6-chloro-2-fluoro-3-pyridinyl)-
- (6-Chloro-2-fluoropyridin-3-yl)boronic acid - [C18067]
- 1256345-66-0
