N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID
|
|
|
- CAS-Nr.
- 154509-63-4
- Englisch Name:
- N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID
- Synonyma:
- Boc-N(iPr)Gly-OH;N-Boc-N-(1-methylethyl)glycine;N-Boc-N-isopropylamino-acetic ac;N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID;N-Isopropylglycine, N-BOC protected;N-(tert-Butoxycarbonyl)-N-isopropylglycine;N-Boc-N-isopropylamino-acetic acid;(tert-Butoxycarbonyl-isopropyl-amino)-acetic acid;2-{[(tert-butoxy)carbonyl](propan-2-yl)amino}acetic acid;Glycine, N-[(1,1-dimethylethoxy)carbonyl]-N-(1-methylethyl)-
- CBNumber:
- CB4849449
- Summenformel:
- C10H19NO4
- Molgewicht:
- 217.26
- MOL-Datei:
- 154509-63-4.mol
|
N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID Eigenschaften
- Siedepunkt:
- 312.4±21.0 °C(Predicted)
- Dichte
- 1.089±0.06 g/cm3(Predicted)
- storage temp.
- Store at room temperature, keep dry and cool
- Aggregatzustand
- crystals
- pka
- 4.00±0.10(Predicted)
- Farbe
- Colourless
- InChI
- 1S/C10H19NO4/c1-7(2)11(6-8(12)13)9(14)15-10(3,4)5/h7H,6H2,1-5H3,(H,12,13)
- InChIKey
- VDWLWSLMCAPRCS-UHFFFAOYSA-N
- SMILES
- CC(N(C(OC(C)(C)C)=O)CC(O)=O)C
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| HS Code |
2922498590 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral |
|
|
| Bildanzeige (GHS) |
 
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H317 |
Kann allergische Hautreaktionen verursachen. |
Sensibilisierung der Haut |
Kategorie 1A |
Warnung |
|
P261, P272, P280, P302+P352,P333+P313, P321, P363, P501 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H340 |
Kann genetische Defekte verursachen. |
Keimzellmutagenit?t |
Kategorie 1B |
Achtung |
|
|
| H350 |
Kann Krebs verursachen. |
Karzinogenit?t |
Kategorie 1A |
Achtung |
|
|
| H360 |
Kann die Fruchtbarkeit beeintr?chtigen oder das Kind im Mutterleib sch?digen. |
Fertility (Fruchtbarkeit) |
Kategorie 1 |
Achtung |
|
|
| H370 |
Sch?digt die Organe. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 1 |
Achtung |
|
P260, P264, P270, P307+P311, P321,P405, P501 |
| H372 |
Sch?digt bei Hautkontakt und Verschlucken die Organe bei l?ngerer oder wiederholter Exposition. |
Spezifische Zielorgan-Toxizit?t (wiederholte Exposition) |
Kategorie 1 |
Achtung |
|
P260, P264, P270, P314, P501 |
| H402 |
Harmful to aquatic life |
Hazardous to the aquatic environment, acute hazard |
Category 3 |
|
|
|
|
| Sicherheit |
| P201 |
Vor Gebrauch besondere Anweisungen einholen. |
| P202 |
Vor Gebrauch alle Sicherheitshinweise lesen und verstehen. |
| P260 |
Dampf/Aerosol/Nebel nicht einatmen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P272 |
Kontaminierte Arbeitskleidung nicht au?erhalb des Arbeitsplatzes tragen. |
| P273 |
Freisetzung in die Umwelt vermeiden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P333+P313 |
Bei Hautreizung oder -ausschlag: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P501 |
Inhalt/Beh?lter ... (Entsorgungsvorschriften vom Hersteller anzugeben) zuführen. |
|
N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID Chemische Eigenschaften,Einsatz,Produktion Methoden
N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 26)Lieferanten
- N-BOC-N-ISOPROPYL-AMINO-ACETIC ACID
- N-Boc-N-(1-methylethyl)glycine
- (tert-Butoxycarbonyl-isopropyl-amino)-acetic acid
- 2-{[(tert-butoxy)carbonyl](propan-2-yl)amino}acetic acid
- N-Isopropylglycine, N-BOC protected
- Boc-N(iPr)Gly-OH
- Glycine, N-[(1,1-dimethylethoxy)carbonyl]-N-(1-methylethyl)-
- N-Boc-N-isopropylamino-acetic ac
- 2-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]acetic acid
- N-Boc-N-isopropylamino-acetic acid
- N-(tert-Butoxycarbonyl)-N-isopropylglycine
- 154509-63-4
