(S)-(+)-Naproxen chloride
|
|
|
- CAS-Nr.
- 51091-84-0
- Englisch Name:
- (S)-(+)-Naproxen chloride
- Synonyma:
- (S)-2-(6-Methoxynaphthalen-2-yl)propanoyl chloride;NAPRO-017;Sparsentan Impurity 14;(S)-(+)-Naproxen chloride;(S)-(+)-Naproxen chloride;(S)-(+)-Naproxen chloride >=97.0%;(S)-2-(6-Methoxy-2-naphthyl)propanoyl Chloride;(2S)-2-(6-methoxy-2-naphthyl)propanoyl chloride;(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride;2-Naphthaleneacetyl chloride, 6-methoxy-α-methyl-, (αS)-
- CBNumber:
- CB52637885
- Summenformel:
- C14H13ClO2
- Molgewicht:
- 248.7
- MOL-Datei:
- 51091-84-0.mol
|
(S)-(+)-Naproxen chloride Eigenschaften
- Schmelzpunkt:
- 94-96 °C
- Siedepunkt:
- 371.6±25.0 °C(Predicted)
- Dichte
- 1.206±0.06 g/cm3(Predicted)
- storage temp.
- 2-8°C
- Aggregatzustand
- crystals
- Aussehen
- White to off-white Solid
- Optische Rotation
- [α]/D +67.0±3.0°, c = 1 in methylene chloride
- InChI
- 1S/C14H13ClO2/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3/t9-/m0/s1
- InChIKey
- UODROGXCIVAQDJ-VIFPVBQESA-N
- SMILES
- COc1ccc2cc(ccc2c1)[C@H](C)C(Cl)=O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36-52 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
(S)-(+)-Naproxen chloride Chemische Eigenschaften,Einsatz,Produktion Methoden
(S)-(+)-Naproxen chloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
(S)-(+)-Naproxen chloride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 28)Lieferanten
- (S)-(+)-Naproxen chloride
- (S)-(+)-Naproxen chloride >=97.0%
- NAPRO-017
- 2-Naphthaleneacetyl chloride, 6-methoxy-α-methyl-, (αS)-
- (2S)-2-(6-methoxy-2-naphthyl)propanoyl chloride
- (S)-2-(6-Methoxy-2-naphthyl)propanoyl Chloride
- (2S)-2-(6-methoxynaphthalen-2-yl)propanoyl chloride
- Sparsentan Impurity 14
- (S)-(+)-Naproxen chloride
- (2S)-2-(6-methoxy-2-naphthyl)propanoyl chloride - [M86864]
- (S)-2-(6-Methoxynaphthalen-2-yl)propanoyl chloride
- 51091-84-0
