Sparstolonin B
|
|
|
- CAS-Nr.
- 1259330-61-4
- Englisch Name:
- Sparstolonin B
- Synonyma:
- Sparstolonin B;Sparstolonin B (SsnB);Sparstolonin B >=98% (HPLC);3H-Pyrano[3,4,5-kl]xanthen-3-one, 4,10-dihydroxy-
- CBNumber:
- CB54670606
- Summenformel:
- C15H8O5
- Molgewicht:
- 268.22
- MOL-Datei:
- 1259330-61-4.mol
|
Sparstolonin B Eigenschaften
- storage temp.
- 2-8°C
- L?slichkeit
- DMSO : 10 mg/mL (Need ultrasonic and warming)
- Aggregatzustand
- powder
- Farbe
- white to beige
- InChI
- 1S/C15H8O5/c16-7-1-3-11-8(5-7)9-6-19-15(18)14-10(17)2-4-12(20-11)13(9)14/h1-6,16-17H
- InChIKey
- DHSASSJDMAHICE-UHFFFAOYSA-N
- SMILES
- OC(C=C1)=CC2=C1OC3=C4C(C(OC=C42)=O)=C(O)C=C3
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
WGK 3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
|
Sparstolonin B Chemische Eigenschaften,Einsatz,Produktion Methoden
Biochem/physiol Actions
Sparstolonin B (SsnB) is a polyphenol. It has a structural features similar to xanthone and isocoumarin. SsnB exerts anti-inflammatory properties on mouse and human macrophages. SsnB can significantly reduce hypoxia–reoxygenation-induced inflammation of cardiomyocytes by blocking extracellular signal-regulated protein kinase (ERK1/2) and c-jun N-terminal kinases (JNK) signaling pathways. Thus, SsnB acts as a potent therapeutic for the treatment of myocardial ischemia–reperfusion (MIR) injury.
Sparstolonin B Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Sparstolonin B Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 31)Lieferanten
- Sparstolonin B
- 3H-Pyrano[3,4,5-kl]xanthen-3-one, 4,10-dihydroxy-
- Sparstolonin B >=98% (HPLC)
- Sparstolonin B (SsnB)
- 1259330-61-4