1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid
|
|
|
- CAS-Nr.
- 33972-97-3
- Englisch Name:
- 1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid
- Synonyma:
- 1-Methyl-2-oxo-1,2-dihydr...;1-Methyl-2-pyridone-4-carboxylic acid;1-methyl-2-oxopyridine-4-carboxylicaci;1-methyl-2-oxo-4-pyridinecarboxylic acid;1-methyl-2-oxopyridine-4-carboxylic acid;1-Methyl-2-oxo-1,2-dihydro-4-pyridine carboxylic a;1-methyl-2-oxo-1,2-dihydro-4-pyridinecarboxylic acid;4-Pyridinecarboxylic acid, 1,2-dihydro-1-Methyl-2-oxo-;1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid;1-methyl-2-oxo-1,2-dihydro-4-pyridinecarboxylic acid(SALTDATA: FREE)
- CBNumber:
- CB61096213
- Summenformel:
- C7H7NO3
- Molgewicht:
- 153.14
- MOL-Datei:
- 33972-97-3.mol
|
1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid Eigenschaften
- Schmelzpunkt:
- 260 °C
- Siedepunkt:
- 329.6±35.0 °C(Predicted)
- Dichte
- 1.381±0.06 g/cm3(Predicted)
- storage temp.
- Inert atmosphere,Room Temperature
- Aggregatzustand
- solid
- pka
- 2.75±0.20(Predicted)
- Aussehen
- Light yellow to yellow Solid
- InChI
- InChI=1S/C7H7NO3/c1-8-3-2-5(7(10)11)4-6(8)9/h2-4H,1H3,(H,10,11)
- InChIKey
- XUKWOJNDLIOXSC-UHFFFAOYSA-N
- SMILES
- C1(=O)N(C)C=CC(C(O)=O)=C1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
2933399990 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H312 |
Gesundheitssch?dlich bei Hautkontakt. |
Akute Toxizit?t dermal |
Kategorie 4 |
Warnung |
 |
P280,P302+P352, P312, P322, P363,P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H332 |
Gesundheitssch?dlich bei Einatmen. |
Akute Toxizit?t inhalativ |
Kategorie 4 |
Warnung |
 |
P261, P271, P304+P340, P312 |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P271 |
Nur im Freien oder in gut belüfteten R?umen verwenden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P304+P340 |
BEI EINATMEN: Die Person an die frische Luft bringen und für ungehinderte Atmung sorgen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P330 |
Mund ausspülen. |
| P332+P313 |
Bei Hautreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P337+P313 |
Bei anhaltender Augenreizung: ?rztlichen Rat einholen/?rztliche Hilfe hinzuziehen. |
| P362 |
Kontaminierte Kleidung ausziehen und vor erneutem Tragen waschen. |
|
1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 77)Lieferanten
- 1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid
- 4-Pyridinecarboxylic acid, 1,2-dihydro-1-Methyl-2-oxo-
- 1-Methyl-2-oxo-1,2-dihydro-4-pyridine carboxylic a
- 1-Methyl-2-oxo-1,2-dihydr...
- 1-methyl-2-oxo-1,2-dihydro-4-pyridinecarboxylic acid(SALTDATA: FREE)
- 1-methyl-2-oxo-1,2-dihydro-4-pyridinecarboxylic acid
- 1-methyl-2-oxopyridine-4-carboxylic acid
- 1-Methyl-2-pyridone-4-carboxylic acid
- 1-methyl-2-oxo-4-pyridinecarboxylic acid
- 1-methyl-2-oxopyridine-4-carboxylicaci
- 1-Methylthyl-2-oxo-1,2-dihydropyridine-4-carboxylic acid ISO 9001:2015 REACH
- 33972-97-3