2,4-Dichloro-3-cyanophenylboronic acid
|
|
|
- CAS-Nr.
- 957120-87-5
- Englisch Name:
- 2,4-Dichloro-3-cyanophenylboronic acid
- Synonyma:
- 2,4-Dichloro-3-cyanophenylboronic acid;2,4-DDichloro-3-cyanophenylboronic acid;Boronic acid, B-(2,4-dichloro-3-cyanophenyl)-
- CBNumber:
- CB61457249
- Summenformel:
- C7H4BCl2NO2
- Molgewicht:
- 215.83
- MOL-Datei:
- 957120-87-5.mol
|
2,4-Dichloro-3-cyanophenylboronic acid Eigenschaften
- Schmelzpunkt:
- 287-289° C
- storage temp.
- under inert gas (nitrogen or Argon) at 2-8°C
- Aggregatzustand
- solid
- Aussehen
- White to off-white Solid
- InChI
- 1S/C7H4BCl2NO2/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-2,12-13H
- InChIKey
- FFNJVSXDMXUODJ-UHFFFAOYSA-N
- SMILES
- OB(C1=CC=C(C(C#N)=C1Cl)Cl)O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| HazardClass |
IRRITANT |
|
|
| HS Code |
2931900090 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2,4-Dichloro-3-cyanophenylboronic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
suzuki reaction
2,4-Dichloro-3-cyanophenylboronic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2,4-Dichloro-3-cyanophenylboronic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 59)Lieferanten
957120-87-5()Verwandte Suche:
- 2,4-Dichloro-3-cyanophenylboronic acid
- 2,4-DDichloro-3-cyanophenylboronic acid
- Boronic acid, B-(2,4-dichloro-3-cyanophenyl)-
- 957120-87-5
- blocks
- BoronicAcids
- Carboxes
