2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
|
|
|
- CAS-Nr.
- 1257649-56-1
- Englisch Name:
- 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
- Synonyma:
- 4-Iodophenylboronic acid MIDA ester;4-Iodobenzeneboronic acid methyliminodiacetic acid ester;2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione;4-Iodophenylboronic acid MIDA ester(contains varying amounts of Anhydride)
- CBNumber:
- CB62094461
- Summenformel:
- C11H11BINO4
- Molgewicht:
- 358.92481
- MOL-Datei:
- 1257649-56-1.mol
|
2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Eigenschaften
- Schmelzpunkt:
- 213-217 °C
- Aggregatzustand
- solid
- InChI
- 1S/C11H11BINO4/c1-14-6-10(15)17-12(18-11(16)7-14)8-2-4-9(13)5-3-8/h2-5H,6-7H2,1H3
- InChIKey
- KIKNJEGAWBNFLW-UHFFFAOYSA-N
- SMILES
- CN1CC(=O)OB(OC(=O)C1)c2ccc(I)cc2
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xn |
|
|
| R-S?tze: |
22 |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
13 - Non Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Chemische Eigenschaften,Einsatz,Produktion Methoden
R-S?tze Betriebsanweisung:
R22:Gesundheitssch?dlich beim Verschlucken.
Verwenden
4-Iodophenylboronic acid MIDA ester can be used:
- As a starting material to prepare rod-like hydrogen-bonded organic frameworks through Stille-coupling using 2,5-bis(trimethyltin)heterocycle, Pd(PPh3)4, and CuI.
- As a substrate in the C-H arylation reaction of pyroglutamic acid derivatives with aryl and heteroaryl iodides; catalyzed by the palladium catalyst.
- As a substrate in the synthesis of trifluoroborates, which are further converted to protected boronic acids.
- As a starting material in the synthesis of amino acid MIDA boronates as new building blocks by reacting with protected iodoalanine.
2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 21)Lieferanten
- 2-(4-Iodophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione
- 4-Iodophenylboronic acid MIDA ester
- 4-Iodophenylboronic acid MIDA ester(contains varying amounts of Anhydride)
- 4-Iodobenzeneboronic acid methyliminodiacetic acid ester
- 1257649-56-1
