2-Bromomethylphenylboronic acid MIDA ester
|
|
|
- CAS-Nr.
- 1257740-52-5
- Englisch Name:
- 2-Bromomethylphenylboronic acid MIDA ester
- Synonyma:
- 2-Bromomethylphenylboronic acid MIDA ester;Boron, [2-(bromomethyl)phenyl][N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κ...;8-(2-(Bromomethyl)phenyl)-4-methyldihydro-4lambda4,8lambda4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione
- CBNumber:
- CB62524197
- Summenformel:
- C12H13BBrNO4
- Molgewicht:
- 325.95092
- MOL-Datei:
- 1257740-52-5.mol
|
2-Bromomethylphenylboronic acid MIDA ester Eigenschaften
- Schmelzpunkt:
- 196-202°C
- Aggregatzustand
- powder
- InChI
- 1S/C12H13BBrNO4/c1-15-7-11(16)18-13(19-12(17)8-15)10-5-3-2-4-9(10)6-14/h2-5H,6-8H2,1H3
- InChIKey
- GUOSLMTXTQNEPM-UHFFFAOYSA-N
- SMILES
- CN1CC(=O)OB(OC(=O)C1)c2ccccc2CBr
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xn |
|
|
| R-S?tze: |
22 |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Acute Tox. 4 Oral |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
|
| Sicherheit |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P270 |
Bei Gebrauch nicht essen, trinken oder rauchen. |
| P301+P312 |
BEI VERSCHLUCKEN: Bei Unwohlsein GIFTINFORMATIONSZENTRUM/Arzt/... (geeignete Stelle für medizinische Notfallversorgung vom Hersteller/Lieferanten anzugeben) anrufen. |
| P330 |
Mund ausspülen. |
| P501 |
Inhalt/Beh?lter ... (Entsorgungsvorschriften vom Hersteller anzugeben) zuführen. |
|
2-Bromomethylphenylboronic acid MIDA ester Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
Suzuki Cross-Coupling with MIDA Boronates
2-Bromomethylphenylboronic acid MIDA ester Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Bromomethylphenylboronic acid MIDA ester Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 7)Lieferanten
- 2-Bromomethylphenylboronic acid MIDA ester
- 8-(2-(Bromomethyl)phenyl)-4-methyldihydro-4lambda4,8lambda4-[1,3,2]oxazaborolo[2,3-b][1,3,2]oxazaborole-2,6(3H,5H)-dione
- Boron, [2-(bromomethyl)phenyl][N-[(carboxy-κO)methyl]-N-methylglycinato(2-)-κ...
- 1257740-52-5
