[13C]-9-Methylfluorene-9-carbonyl chloride
|
|
|
- CAS-Nr.
- 1072315-89-9
- Englisch Name:
- [13C]-9-Methylfluorene-9-carbonyl chloride
- Synonyma:
- 13COgen;[13C]-9-Methylfluorene-9-carbonyl chloride;9-Methyl-9H-fluorene-9-carbonyl-13C chloride;9-Methyl-9H-fluorene-9-carbonyl-13C chloride >=97.0% (GC);9-Methyl-9H-fluorene-9-carbonyl-13C chloride
- CBNumber:
- CB62598262
- Summenformel:
- C15H11ClO
- Molgewicht:
- 243.70924
- MOL-Datei:
- 1072315-89-9.mol
|
[13C]-9-Methylfluorene-9-carbonyl chloride Eigenschaften
- Flammpunkt:
- >110℃
- Aggregatzustand
- solid
- InChI
- 1S/C15H11ClO/c1-15(14(16)17)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9H,1H3/i14+1
- InChIKey
- ZQYOOHGEBHBNTP-UJKGMGNHSA-N
- SMILES
- CC1(c2ccccc2-c3ccccc13)[13C](Cl)=O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
C |
|
|
| R-S?tze: |
34 |
|
|
| S-S?tze: |
26-36/37/39-45 |
|
|
| RIDADR |
UN 3261 8 / PGII |
|
|
| WGK Germany |
3 |
|
|
| Speicherklasse |
8A - Combustible corrosive hazardous materials |
|
|
| Hazard Classifications |
Eye Dam. 1
Skin Corr. 1B |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H314 |
Verursacht schwere Ver?tzungen der Haut und schwere Augensch?den. |
?tzwirkung auf die Haut |
Kategorie 1B |
Achtung |
|
P260,P264, P280, P301+P330+ P331,P303+P361+P353, P363, P304+P340,P310, P321, P305+ P351+P338, P405,P501 |
|
| Sicherheit |
| P260 |
Dampf/Aerosol/Nebel nicht einatmen. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P303+P361+P353 |
BEI BERüHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen oder duschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
| P363 |
Kontaminierte Kleidung vor erneutem Tragen waschen. |
|
[13C]-9-Methylfluorene-9-carbonyl chloride Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
COGen is a simple alternative for carbon monoxide generation in the application of palladium-catalyzed carbonylation reactions. This reagent has proved to be applicable in a wide range of applications and is compatible with several building blocks in the formation of ketones, amides, esters, etc.
For more information please visit:
Technology Spotlight,
Professor Skrystrup PPP
[13C]-9-Methylfluorene-9-carbonyl chloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
[13C]-9-Methylfluorene-9-carbonyl chloride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 6)Lieferanten
- [13C]-9-Methylfluorene-9-carbonyl chloride
- 13COgen
- 9-Methyl-9H-fluorene-9-carbonyl-13C chloride
- 9-Methyl-9H-fluorene-9-carbonyl-13C chloride >=97.0% (GC)
- 9-Methyl-9H-fluorene-9-carbonyl-13C chloride
- 1072315-89-9
