6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester
|
|
|
- CAS-Nr.
- 127094-58-0
- Englisch Name:
- 6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester
- Synonyma:
- Ethyl 6-chloro-4-oxo-1H-1,5-naphthyridine-3-carboxylate;6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester;1,5-Naphthyridine-3-carboxylic acid, 6-chloro-4-hydroxy-, ethyl ester
- CBNumber:
- CB63169441
- Summenformel:
- C11H9ClN2O3
- Molgewicht:
- 252.65
- MOL-Datei:
- 127094-58-0.mol
|
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester Eigenschaften
- Siedepunkt:
- 372.7±37.0 °C(Predicted)
- Dichte
- 1.445±0.06 g/cm3(Predicted)
- pka
- 1.28±0.50(Predicted)
- InChI
- InChI=1S/C11H9ClN2O3/c1-2-17-11(16)6-5-13-7-3-4-8(12)14-9(7)10(6)15/h3-5H,2H2,1H3,(H,13,15)
- InChIKey
- XNSPDXHNZQVZRQ-UHFFFAOYSA-N
- SMILES
- N1C2C(=NC(Cl)=CC=2)C(O)=C(C(OCC)=O)C=1
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitssch?dlich bei Verschlucken. |
Akute Toxizit?t oral |
Kategorie 4 |
Warnung |
|
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester Chemische Eigenschaften,Einsatz,Produktion Methoden
Beschreibung
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester, characterized by its nitrogen-containing aromatic ring, has potential as a building block in the synthesis of pharmaceuticals, agrochemicals, and advanced materials.
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 37)Lieferanten
- 6-Chloro-4-hydroxy-[1,5]naphthyridine-3-carboxylic acid ethyl ester
- 1,5-Naphthyridine-3-carboxylic acid, 6-chloro-4-hydroxy-, ethyl ester
- Ethyl 6-chloro-4-oxo-1H-1,5-naphthyridine-3-carboxylate
- 127094-58-0
