4-(Trifluoromethylsulfony)phenylacetic acid
|
|
|
- CAS-Nr.
- 1099597-82-6
- Englisch Name:
- 4-(Trifluoromethylsulfony)phenylacetic acid
- Synonyma:
- 4-(Trifluoromethylsulfony)phenylacetic acid;2-(4-trifluoromethanesulfonylphenyl)acetic acid;4-(Trifluoromethylsulfonyl)phenylaceticacid,98%;4-[(Trifluoromethyl)sulfonyl]benzeneacetic acid;2-[4-(trifluoromethylsulfonyl)phenyl]acetic acid;4-(Trifluoromethylsulfonyl)phenylacetic acid 97%;Benzeneacetic acid, 4-[(trifluoromethyl)sulfonyl]-;4-(Trifluoromethylsulfonyl)phenylacetic acid
- CBNumber:
- CB71566498
- Summenformel:
- C9H7F3O4S
- Molgewicht:
- 268.21
- MOL-Datei:
- 1099597-82-6.mol
|
4-(Trifluoromethylsulfony)phenylacetic acid Eigenschaften
- Schmelzpunkt:
- 125-128℃
- Siedepunkt:
- 381.8±42.0 °C(Predicted)
- Dichte
- 1.532±0.06 g/cm3(Predicted)
- pka
- 3.78±0.10(Predicted)
- Aggregatzustand
- solid
- Wasserl?slichkeit
- Slightly soluble in water, soluble in organic solvents.
- InChI
- 1S/C9H7F3O4S/c10-9(11,12)17(15,16)7-3-1-6(2-4-7)5-8(13)14/h1-4H,5H2,(H,13,14)
- InChIKey
- FIEUCHICQSJBAU-UHFFFAOYSA-N
- SMILES
- OC(=O)Cc1ccc(cc1)S(=O)(=O)C(F)(F)F
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
Xi |
|
|
| R-S?tze: |
36/37/38 |
|
|
| S-S?tze: |
26 |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
2930909899 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Hazard Classifications |
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
|
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizit?t (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
|
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P264 |
Nach Gebrauch gründlich waschen. |
| P271 |
Nur im Freien oder in gut belüfteten R?umen verwenden. |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P302+P352 |
BEI BERüHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckm??ig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
4-(Trifluoromethylsulfony)phenylacetic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
4-(Trifluoromethylsulfonyl)phenylacetic acid, is used as a primary and secondary intermediate.
4-(Trifluoromethylsulfony)phenylacetic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
4-(Trifluoromethylsulfony)phenylacetic acid Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 22)Lieferanten
- 4-(Trifluoromethylsulfony)phenylacetic acid
- 4-[(Trifluoromethyl)sulfonyl]benzeneacetic acid
- 4-(Trifluoromethylsulfonyl)phenylacetic acid 97%
- 2-[4-(trifluoromethylsulfonyl)phenyl]acetic acid
- Benzeneacetic acid, 4-[(trifluoromethyl)sulfonyl]-
- 4-(Trifluoromethylsulfonyl)phenylaceticacid,98%
- 2-(4-trifluoromethanesulfonylphenyl)acetic acid
- 4-(Trifluoromethylsulfonyl)phenylacetic acid
- 1099597-82-6
