2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride
|
|
|
- CAS-Nr.
- 1099597-75-7
- Englisch Name:
- 2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride
- Synonyma:
- 2-chloro-5-(trifluoroMethyl)nicotinoyl chloride;2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride;3-Pyridinecarbonyl chloride, 2-chloro-5-(trifluoromethyl)-
- CBNumber:
- CB72477959
- Summenformel:
- C7H2Cl2F3NO
- Molgewicht:
- 244
- MOL-Datei:
- 1099597-75-7.mol
|
2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride Eigenschaften
- Dichte
- 1.585g/mLat 25℃
- Brechungsindex
- n20/D 1.496
- Flammpunkt:
- >110°C
- storage temp.
- -20°C
- Aggregatzustand
- liquid
- InChI
- 1S/C7H2Cl2F3NO/c8-5-4(6(9)14)1-3(2-13-5)7(10,11)12/h1-2H
- InChIKey
- CEQQAPUZEUIPCH-UHFFFAOYSA-N
- SMILES
- FC(F)(F)c1cnc(Cl)c(c1)C(Cl)=O
Sicherheit
- Risiko- und Sicherheitserkl?rung
- Gefahreninformationscode (GHS)
| Kennzeichnung gef?hrlicher |
T,C |
|
|
| R-S?tze: |
23/24/25-34 |
|
|
| S-S?tze: |
26-36/37/39-45 |
|
|
| RIDADR |
UN 2922 6.1(8) / PGIII |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
IRRITANT |
|
|
| HS Code |
2933399990 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Skin Corr. 1B |
|
|
| Bildanzeige (GHS) |

|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H314 |
Verursacht schwere Ver?tzungen der Haut und schwere Augensch?den. |
?tzwirkung auf die Haut |
Kategorie 1B |
Achtung |
 |
P260,P264, P280, P301+P330+ P331,P303+P361+P353, P363, P304+P340,P310, P321, P305+ P351+P338, P405,P501 |
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P301+P330+P331 |
BEI VERSCHLUCKEN: Mund ausspülen. KEIN Erbrechen herbeiführen. |
| P303+P361+P353 |
BEI BERüHRUNG MIT DER HAUT (oder dem Haar): Alle kontaminierten Kleidungsstücke sofort ausziehen. Haut mit Wasser abwaschen oder duschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach M?glichkeit entfernen. Weiter spülen. |
|
2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride Chemische Eigenschaften,Einsatz,Produktion Methoden
2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride Anbieter Lieferant Produzent Hersteller Vertrieb H?ndler.
Global( 18)Lieferanten
- 2-chloro-5-(trifluoroMethyl)nicotinoyl chloride
- 2-Chloro-5-(trifluoromethyl)pyridine-3-carbonylchloride
- 3-Pyridinecarbonyl chloride, 2-chloro-5-(trifluoromethyl)-
- 1099597-75-7
- Pyridines
- Organic Building Blocks
- Heterocyclic Building Blocks
- Chemical Synthesis
- Carbonyl Compounds
- C7 to C8
- Building Blocks
- Acid Halides